loading...| Preferred Name | perindopril | |
| Synonyms |
perindopril perindoprilum (2S,3aS,7aS)-1-[(2S)-2-{[(2S)-1-ethoxy-1-oxopentan-2-yl]amino}propanoyl]octahydro-1H-indole-2-carboxylic acid ethyl N-{(2S)-1-[(2S,3aS,7aS)-2-carboxyoctahydro-1H-indol-1-yl]-1-oxopropan-2-yl}-L-norvalinate |
|
| Definitions |
An alpha-amino acid ester that is the ethyl ester of N-{(2S)-1-[(2S,3aS,7aS)-2-carboxyoctahydro-1H-indol-1-yl]-1-oxopropan-2-yl}-L-norvaline |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8024 |
|
| alternative term |
perindopril perindoprilum (2S,3aS,7aS)-1-[(2S)-2-{[(2S)-1-ethoxy-1-oxopentan-2-yl]amino}propanoyl]octahydro-1H-indole-2-carboxylic acid ethyl N-{(2S)-1-[(2S,3aS,7aS)-2-carboxyoctahydro-1H-indol-1-yl]-1-oxopropan-2-yl}-L-norvalinate |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB00790 KEGG:C07706 Reaxys:4300272 PMID:24554346 PMID:24324048 PMID:24590580 PMID:24664905 PMID:24515310 LINCS:LSM-4080 PMID:24291100 HMDB:HMDB0014928 Wikipedia:Perindopril Drug_Central:2108 KEGG:D03753 PMID:24511479 PMID:24602481 CAS:82834-16-0 PMID:24357222 |
|
| formula |
C19H32N2O5 |
|
| has exact synonym |
ethyl N-{(2S)-1-[(2S,3aS,7aS)-2-carboxyoctahydro-1H-indol-1-yl]-1-oxopropan-2-yl}-L-norvalinate |
|
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
perindopril perindoprilum (2S,3aS,7aS)-1-[(2S)-2-{[(2S)-1-ethoxy-1-oxopentan-2-yl]amino}propanoyl]octahydro-1H-indole-2-carboxylic acid |
|
| id |
CHEBI:8024 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C19H32N2O5/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24/h12-16,20H,4-11H2,1-3H3,(H,23,24)/t12-,13-,14-,15-,16-/m0/s1 |
|
| inchikey |
IPVQLZZIHOAWMC-QXKUPLGCSA-N |
|
| is conjugate acid of | ||
| label |
perindopril |
|
| mass |
368.46786 |
|
| monoisotopicmass |
368.23112 |
|
| notation |
CHEBI:8024 |
|
| prefLabel |
perindopril |
|
| smiles |
[H][C@@]12CCCC[C@]1([H])N([C@@H](C2)C(O)=O)C(=O)[C@H](C)N[C@@H](CCC)C(=O)OCC |
|
| textual definition |
An alpha-amino acid ester that is the ethyl ester of N-{(2S)-1-[(2S,3aS,7aS)-2-carboxyoctahydro-1H-indol-1-yl]-1-oxopropan-2-yl}-L-norvaline |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_46874 http://purl.obolibrary.org/obo/CHEBI_36244 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.