loading...| Preferred Name |
minoxidil |
|
| Synonyms |
6-(piperidin-1-yl)pyrimidine-2,4-diamine 3-oxide minoxidilum Alostil Apo-Gain Lonolox Minoximen Normoxidil Regaine Rogaine Tricoxidil minoxidil |
|
| Definitions |
A pyrimidine N-oxide that is pyrimidine-2,4-diamine 3-oxide substituted by a piperidin-1-yl group at position 6. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6942 |
|
| charge |
0 |
|
| chemical inhibits protein | ||
| database_cross_reference |
PMID:24742982 Drug_Central:1814 PMID:26024233 Reaxys:886240 Patent:US3382247 KEGG:D00418 PMID:7755612 Patent:RU2012112099 Patent:AU2012316063 Wikipedia:Minoxidil Patent:NL6615385 HMDB:HMDB0014494 CAS:38304-91-5 DrugBank:DB00350 |
|
| definition source |
Reference: PMID: 30481795 |
|
| formula |
C9H15N5O |
|
| has exact synonym |
6-(piperidin-1-yl)pyrimidine-2,4-diamine 3-oxide |
|
| has role | ||
| has_alternative_id |
CHEBI:49774 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
minoxidilum Alostil Apo-Gain Lonolox Minoximen Normoxidil Regaine Rogaine Tricoxidil minoxidil |
|
| has_role | ||
| id |
CHEBI:6942 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C9H15N5O/c10-7-6-8(12-9(11)14(7)15)13-4-2-1-3-5-13/h6H,1-5,10H2,(H2,11,12) |
|
| inchikey |
ZFMITUMMTDLWHR-UHFFFAOYSA-N |
|
| label |
minoxidil |
|
| mass |
209.24830 |
|
| monoisotopicmass |
209.12766 |
|
| notation |
CHEBI:6942 |
|
| prefLabel |
minoxidil |
|
| smiles |
Nc1cc(nc(N)[n+]1[O-])N1CCCCC1 |
|
| textual definition |
A pyrimidine N-oxide that is pyrimidine-2,4-diamine 3-oxide substituted by a piperidin-1-yl group at position 6. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50698 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.