loading...| Preferred Name | lycorine | |
| Synonyms |
Galanthidine (-)-lycorine Amarylline Licorine Narcissine 9,10-(methylenedioxy)-3,12-didehydrogalanthan-1alpha,2beta-diol Lycorine |
|
| Definitions |
An indolizidine alkaloid that is 3,12-didehydrogalanthan substituted by hydroxy groups at positions and 2 and a methylenedioxy group across positions 9 and 10. Isolated from Crinum asiaticum, it has been shown to exhibit antimalarial activity. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6601 |
|
| alternative term |
Galanthidine (-)-lycorine Amarylline Licorine Narcissine 9,10-(methylenedioxy)-3,12-didehydrogalanthan-1alpha,2beta-diol Lycorine |
|
| charge |
0 |
|
| chemical effective in vitro against virus | ||
| chemical inhibits in vitro replication of virus | ||
| database_cross_reference |
PDBeChem:3KD PMID:15386196 Beilstein:93605 PMID:14669261 PMID:12232602 KEGG:C08532 CAS:476-28-8 KNApSAcK:C00001576 PMID:19788245 Reaxys:93605 |
|
| definition source |
PMID: 30918074 |
|
| formula |
C16H17NO4 |
|
| has exact synonym |
9,10-(methylenedioxy)-3,12-didehydrogalanthan-1alpha,2beta-diol Lycorine |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_149553 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Galanthidine (-)-lycorine Amarylline Licorine Narcissine |
|
| id |
CHEBI:6601 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C16H17NO4/c18-11-3-8-1-2-17-6-9-4-12-13(21-7-20-12)5-10(9)14(15(8)17)16(11)19/h3-5,11,14-16,18-19H,1-2,6-7H2/t11-,14-,15+,16+/m0/s1 |
|
| inchikey |
XGVJWXAYKUHDOO-DANNLKNASA-N |
|
| label |
lycorine |
|
| mass |
287.31050 |
|
| monoisotopicmass |
287.11576 |
|
| notation |
CHEBI:6601 |
|
| prefLabel |
lycorine |
|
| smiles |
[H][C@]12[C@H](O)[C@@H](O)C=C3CCN(Cc4cc5OCOc5cc14)[C@@]23[H] |
|
| textual definition |
An indolizidine alkaloid that is 3,12-didehydrogalanthan substituted by hydroxy groups at positions and 2 and a methylenedioxy group across positions 9 and 10. Isolated from Crinum asiaticum, it has been shown to exhibit antimalarial activity. |
|
| subClassOf |