loading...| Preferred Name |
Chloroquine |
|
| Synonyms |
chloroquinum InChIKey=WHTVZRBIWZFKQO-UHFFFAOYSA-N Nivaquine B N(4)-(7-chloro-4-quinolinyl)-N(1),N(1)-diethyl-1,4-pentanediamine InChI=1S/C18H26ClN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21) chloroquine CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12 Aralen Artrichin Bemaphate C18H26ClN3 Capquin Chlorochin Resoquine Reumachlor Sanoquin cloroquina Chloroquine N(4)-(7-chloroquinolin-4-yl)-N(1),N(1)-diethylpentane-1,4-diamine |
|
| Definitions |
A quinoline alkaloid that has formula C18H26ClN3. An aminoquinoline that is quinoline which is substituted at position 4 by a [5-(diethylamino)pentan-2-yl]amino group at at position 7 by chlorine. It is used for the treatment of malaria, hepatic amoebiasis, lupus erythematosus, light-sensitive skin eruptions, and rheumatoid arthritis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3638 |
|
| alternative term |
chloroquinum InChIKey=WHTVZRBIWZFKQO-UHFFFAOYSA-N Nivaquine B N(4)-(7-chloro-4-quinolinyl)-N(1),N(1)-diethyl-1,4-pentanediamine InChI=1S/C18H26ClN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21) chloroquine CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12 Aralen Artrichin Bemaphate C18H26ClN3 Capquin Chlorochin Resoquine Reumachlor Sanoquin cloroquina Chloroquine N(4)-(7-chloroquinolin-4-yl)-N(1),N(1)-diethylpentane-1,4-diamine |
|
| capable of inhibiting activity of | ||
| charge |
0 |
|
| chemical effective in vitro against virus |
http://purl.obolibrary.org/obo/NCBITaxon_694009 |
|
| chemical has protein target |
http://purl.obolibrary.org/obo/PR_Q9BYF1 http://purl.obolibrary.org/obo/PR_P09210 http://purl.obolibrary.org/obo/PR_Q8MU52 http://purl.obolibrary.org/obo/PR_P09429 |
|
| chemical inhibits in vitro invasion of virus |
http://purl.obolibrary.org/obo/NCBITaxon_694009 |
|
| chemical inhibits in vitro replication of virus |
http://purl.obolibrary.org/obo/NCBITaxon_694009 |
|
| chemical inhibits protein |
http://purl.obolibrary.org/obo/PR_P09210 http://purl.obolibrary.org/obo/PR_Q8MU52 http://purl.obolibrary.org/obo/PR_P09429 |
|
| database_cross_reference |
Patent:DE683692 PMID:18052874 Beilstein:482809 LINCS:LSM-1901 PMID:19426658 PDBeChem:CLQ NIST Chemistry WebBook:54-05-7 Wikipedia:Chloroquine PMID:17594118 PMID:23580861 Patent:US2233970 CAS:54-05-7 KEGG:D02366 PMID:23644906 KEGG DRUG:D02366 PMID:23706562 PMID:23891850 PMID:23635029 Drug_Central:607 ChemIDplus:54-05-7 KEGG COMPOUND:C07625 KEGG COMPOUND:54-05-7 PMID:23852712 DrugBank:DB00608 HMDB:HMDB0014746 Reaxys:482809 PMID:23288916 KEGG:C07625 PMID:11198399 Gmelin:781126 PMID:25285162 |
|
| definition source |
https://www.drugbank.ca/drugs/DB00608 PMID: 16837072; PMID: 27344959; PMID: 27916837; PMID: 32150618; PMID: 32020029 |
|
| formula |
C18H26ClN3 |
|
| has exact synonym |
Chloroquine N(4)-(7-chloroquinolin-4-yl)-N(1),N(1)-diethylpentane-1,4-diamine |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_149553 http://purl.obolibrary.org/obo/CHEBI_88230 http://purl.obolibrary.org/obo/CHEBI_50177 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
chloroquinum InChIKey=WHTVZRBIWZFKQO-UHFFFAOYSA-N Nivaquine B N(4)-(7-chloro-4-quinolinyl)-N(1),N(1)-diethyl-1,4-pentanediamine InChI=1S/C18H26ClN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21) chloroquine CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12 Aralen Artrichin Bemaphate C18H26ClN3 Capquin Chlorochin Resoquine Reumachlor Sanoquin cloroquina |
|
| has_RxCUI |
2393 |
|
| id |
CHEBI:3638 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C18H26ClN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21) |
|
| inchikey |
WHTVZRBIWZFKQO-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
Chloroquine chloroquine |
|
| mass |
319.87200 |
|
| monoisotopicmass |
319.18153 |
|
| notation |
CHEBI:3638 |
|
| prefLabel |
Chloroquine |
|
| smiles |
CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12 |
|
| textual definition |
A quinoline alkaloid that has formula C18H26ClN3. An aminoquinoline that is quinoline which is substituted at position 4 by a [5-(diethylamino)pentan-2-yl]amino group at at position 7 by chlorine. It is used for the treatment of malaria, hepatic amoebiasis, lupus erythematosus, light-sensitive skin eruptions, and rheumatoid arthritis. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50995 http://purl.obolibrary.org/obo/CHEBI_36709 http://purl.obolibrary.org/obo/CHEBI_36683 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.