loading...| Preferred Name |
butyric acid |
|
| Synonyms |
CH3-[CH2]2-COOH 1-butyric acid n-butyric acid acide butyrique 1-butanoic acid butanic acid ethylacetic acid propanecarboxylic acid propylformic acid acide butanoique BUTANOIC ACID 1-propanecarboxylic acid Buttersaeure n-butanoic acid butoic acid Butanoic acid 4:0 Butanoate C4:0 butanoic acid butyric acid Butyric acid |
|
| Definitions |
A straight-chain saturated fatty acid that is butane in which one of the terminal methyl groups has been oxidised to a carboxy group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30772 |
|
| alternative term |
CH3-[CH2]2-COOH 1-butyric acid n-butyric acid acide butyrique 1-butanoic acid butanic acid ethylacetic acid propanecarboxylic acid propylformic acid acide butanoique BUTANOIC ACID 1-propanecarboxylic acid Buttersaeure n-butanoic acid butoic acid Butanoic acid 4:0 Butanoate C4:0 butanoic acid butyric acid Butyric acid |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Butyric_acid PMID:19318247 PMID:14962641 PMID:12068484 PMID:19366864 HMDB:HMDB0000039 PMID:22038864 PMID:10736622 PMID:15810631 PMID:21699495 PMID:15938880 Reaxys:906770 PMID:22339023 PMID:11208715 MetaCyc:BUTYRIC_ACID DrugBank:DB03568 Gmelin:26242 Beilstein:906770 PMID:15809727 CAS:107-92-6 PMID:11305323 PMID:1542095 PMID:10956204 PMID:22322557 PMID:22466881 PDBeChem:BUA PMID:22194341 PMID:13678314 PMID:11201044 KNApSAcK:C00001180 PMID:19703412 PMID:11238216 KEGG:C00246 LIPID_MAPS_instance:LMFA01010004 |
|
| formula |
C4H8O2 |
|
| has exact synonym |
butanoic acid butyric acid Butyric acid |
|
| has role | ||
| has_alternative_id |
CHEBI:22948 CHEBI:41208 CHEBI:113450 CHEBI:3234 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
CH3-[CH2]2-COOH 1-butyric acid n-butyric acid acide butyrique 1-butanoic acid butanic acid ethylacetic acid propanecarboxylic acid propylformic acid acide butanoique BUTANOIC ACID 1-propanecarboxylic acid Buttersaeure n-butanoic acid butoic acid Butanoic acid 4:0 Butanoate C4:0 |
|
| id |
CHEBI:30772 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6) |
|
| inchikey |
FERIUCNNQQJTOY-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
butyric acid |
|
| mass |
88.10510 |
|
| monoisotopicmass |
88.05243 |
|
| notation |
CHEBI:30772 |
|
| prefLabel |
butyric acid |
|
| smiles |
CCCC(O)=O |
|
| textual definition |
A straight-chain saturated fatty acid that is butane in which one of the terminal methyl groups has been oxidised to a carboxy group. |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.