loading...| Preferred Name |
digitoxin |
|
| Synonyms |
3beta-[2,6-dideoxy-beta-D-ribo-hexopyranosyl-(1->4)-2,6-dideoxy-beta-D-ribo-hexopyranosyl-(1->4)-2,6-dideoxy-beta-D-ribo-hexopyranosyloxy]-14-hydroxy-5beta-card-20(22)-enolide Digitoxin Digitoxoside Crystodigin (TN) |
|
| Definitions |
A cardenolide glycoside in which the 3beta-hydroxy group of digitoxigenin carries a 2,6-dideoxy-beta-D-ribo-hexopyranosyl-(1->4)-2,6-dideoxy-beta-D-ribo-hexopyranosyl-(1->4)-2,6-dideoxy-beta-D-ribo-hexopyranosyl trisaccharide chain. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28544 |
|
| charge |
0 |
|
| chemical inhibits in vitro replication of virus | ||
| chemical inhibits protein | ||
| database_cross_reference |
KEGG:C06955 Wikipedia:Digitoxin Drug_Central:881 KNApSAcK:C00003617 DrugBank:DB01396 Beilstein:76678 PMID:26573786 PMID:10438974 PMID:10687899 CAS:71-63-6 Reaxys:76678 KEGG:D00297 |
|
| definition source |
https://www.drugbank.ca/drugs/DB01396 PMID: 32366720; PMID: 29321306 |
|
| formula |
C41H64O13 |
|
| has exact synonym |
3beta-[2,6-dideoxy-beta-D-ribo-hexopyranosyl-(1->4)-2,6-dideoxy-beta-D-ribo-hexopyranosyl-(1->4)-2,6-dideoxy-beta-D-ribo-hexopyranosyloxy]-14-hydroxy-5beta-card-20(22)-enolide Digitoxin |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:23728 CHEBI:4549 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Digitoxoside Crystodigin (TN) |
|
| id |
CHEBI:28544 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C41H64O13/c1-20-36(46)29(42)16-34(49-20)53-38-22(3)51-35(18-31(38)44)54-37-21(2)50-33(17-30(37)43)52-25-8-11-39(4)24(15-25)6-7-28-27(39)9-12-40(5)26(10-13-41(28,40)47)23-14-32(45)48-19-23/h14,20-22,24-31,33-38,42-44,46-47H,6-13,15-19H2,1-5H3/t20-,21-,22-,24-,25+,26-,27+,28-,29+,30+,31+,33+,34+,35+,36-,37-,38-,39+,40-,41+/m1/s1 |
|
| inchikey |
WDJUZGPOPHTGOT-XUDUSOBPSA-N |
|
| is conjugate acid of | ||
| label |
digitoxin |
|
| mass |
764.93910 |
|
| monoisotopicmass |
764.43469 |
|
| notation |
CHEBI:28544 |
|
| prefLabel |
digitoxin |
|
| smiles |
[H][C@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@]([H])(CC[C@]34O)C3=CC(=O)OC3)[C@@]1(C)CC[C@@H](C2)O[C@H]1C[C@H](O)[C@H](O[C@H]2C[C@H](O)[C@H](O[C@H]3C[C@H](O)[C@H](O)[C@@H](C)O3)[C@@H](C)O2)[C@@H](C)O1 |
|
| textual definition |
A cardenolide glycoside in which the 3beta-hydroxy group of digitoxigenin carries a 2,6-dideoxy-beta-D-ribo-hexopyranosyl-(1->4)-2,6-dideoxy-beta-D-ribo-hexopyranosyl-(1->4)-2,6-dideoxy-beta-D-ribo-hexopyranosyl trisaccharide chain. |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.