loading...| Preferred Name | asparagine | |
| Synonyms |
DL-Asparagine 2,4-diamino-4-oxobutanoic acid 2-amino-3-carbamoylpropanoic acid ASN Asn Asparagin Hasp N asparagina asparagine |
|
| Definitions |
An alpha-amino acid in which one of the hydrogens attached to the alpha-carbon of glycine is substituted by a 2-amino-2-oxoethyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_22653 |
|
| alternative term |
DL-Asparagine 2,4-diamino-4-oxobutanoic acid 2-amino-3-carbamoylpropanoic acid ASN Asn Asparagin Hasp N asparagina asparagine |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:1723525 Wikipedia:Asparagine KEGG:C16438 PMID:22264337 Reaxys:1723525 PMID:22770225 CAS:3130-87-8 Gmelin:279043 |
|
| formula |
C4H8N2O3 |
|
| has exact synonym |
asparagine |
|
| has part | ||
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
DL-Asparagine 2,4-diamino-4-oxobutanoic acid 2-amino-3-carbamoylpropanoic acid ASN Asn Asparagin Hasp N asparagina |
|
| id |
CHEBI:22653 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9) |
|
| inchikey |
DCXYFEDJOCDNAF-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| label |
asparagine |
|
| mass |
132.11800 |
|
| monoisotopicmass |
132.05349 |
|
| notation |
CHEBI:22653 |
|
| prefLabel |
asparagine |
|
| smiles |
NC(CC(N)=O)C(O)=O |
|
| textual definition |
An alpha-amino acid in which one of the hydrogens attached to the alpha-carbon of glycine is substituted by a 2-amino-2-oxoethyl group. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33704 |