loading...| Preferred Name |
L-cysteine |
|
| Synonyms |
L-Cysteine L-cysteine (2R)-2-amino-3-sulfanylpropanoic acid (R)-2-amino-3-mercaptopropanoic acid L-2-Amino-3-mercaptopropionic acid FREE CYSTEINE (2R)-2-amino-3-mercaptopropanoic acid C CYSTEINE Cys E 920 E-920 E920 L-Cystein L-Zystein |
|
| Definitions |
An optically active form of cysteine having L-configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17561 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:1721408 PDBeChem:CYS YMDB:YMDB00046 DrugBank:DB00151 Wikipedia:Cysteine CAS:52-90-4 HMDB:HMDB0000574 MetaCyc:CYS KNApSAcK:C00001351 PMID:13761469 KEGG:D00026 Gmelin:49991 PMID:22735334 KEGG:C00097 PMID:11732994 Drug_Central:769 ECMDB:ECMDB00574 Reaxys:1721408 |
|
| formula |
C3H7NO2S |
|
| has exact synonym |
L-Cysteine L-cysteine |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_77703 |
|
| has_alternative_id |
CHEBI:41781 CHEBI:21261 CHEBI:41768 CHEBI:41227 CHEBI:13095 CHEBI:41811 CHEBI:41700 CHEBI:6207 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(2R)-2-amino-3-sulfanylpropanoic acid (R)-2-amino-3-mercaptopropanoic acid L-2-Amino-3-mercaptopropionic acid FREE CYSTEINE (2R)-2-amino-3-mercaptopropanoic acid C CYSTEINE Cys E 920 E-920 E920 L-Cystein L-Zystein |
|
| id |
CHEBI:17561 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1 |
|
| inchikey |
XUJNEKJLAYXESH-REOHCLBHSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-cysteine |
|
| mass |
121.15800 |
|
| monoisotopicmass |
121.01975 |
|
| notation |
CHEBI:17561 |
|
| prefLabel |
L-cysteine |
|
| smiles |
N[C@@H](CS)C(O)=O |
|
| textual definition |
An optically active form of cysteine having L-configuration. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83813 http://purl.obolibrary.org/obo/CHEBI_15705 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.