Preferred Name |
ticlopidine |
|
Synonyms |
5-(2-chlorobenzyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine ticlopidina ticlopidine ticlopidinum |
|
Definitions |
A thienopyridine that is 4,5,6,7-tetrahydrothieno[3,2-c]pyridine in which the hydrogen attached to the nitrogen is replaced by an o-chlorobenzyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_9588 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:1216802 Patent:US4051141 Patent:US4127580 PMID:19180126 LINCS:LSM-1986 Drug_Central:2657 KEGG:C07140 CAS:55142-85-3 DrugBank:DB00208 KEGG:D08594 Patent:DE2404308 Wikipedia:Ticlopidine |
|
definition |
A thienopyridine that is 4,5,6,7-tetrahydrothieno[3,2-c]pyridine in which the hydrogen attached to the nitrogen is replaced by an o-chlorobenzyl group. |
|
formula |
C14H14ClNS |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_50249 http://purl.obolibrary.org/obo/CHEBI_50248 http://purl.obolibrary.org/obo/CHEBI_50427 |
|
has_exact_synonym |
5-(2-chlorobenzyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
ticlopidina ticlopidine ticlopidinum |
|
id |
CHEBI:9588 |
|
in_subset | ||
inchi |
InChI=1S/C14H14ClNS/c15-13-4-2-1-3-11(13)9-16-7-5-14-12(10-16)6-8-17-14/h1-4,6,8H,5,7,9-10H2 |
|
inchikey |
PHWBOXQYWZNQIN-UHFFFAOYSA-N |
|
label |
ticlopidine |
|
mass |
263.78600 |
|
monoisotopicmass |
263.05355 |
|
notation |
CHEBI:9588 |
|
prefLabel |
ticlopidine |
|
smiles |
Clc1ccccc1CN1CCc2sccc2C1 |
|
treeView | ||
subClassOf |