loading...| Preferred Name | terbutaline | |
| Synonyms |
terbutalinum terbutaline terbutalina 5-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,3-diol |
|
| Definitions |
A member of the class of phenylethanolamines that is catechol substituted at position 5 by a 2-(tert-butylamino)-1-hydroxyethyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9449 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:WO2011112499 PMID:36227333 PMID:35802964 PMID:22310877 PMID:23283786 PMID:21618259 PMID:23126237 Wikipedia:Terbutaline CAS:23031-25-6 PMID:22363704 PMID:23325598 PMID:36715198 PMID:23341043 PMID:9596106 PMID:23075357 Drug_Central:2598 KEGG:D08570 DrugBank:DB00871 PMID:21996060 HMDB:HMDB0015009 PMID:12423672 PMID:8298802 PMID:23204625 PMID:23299764 PMID:36808376 PMID:22767151 PMID:22782385 PMID:12569076 PMID:22813780 KEGG:C07129 Reaxys:2370513 PMID:22988932 PMID:22765375 PMID:22872661 |
|
| definition |
A member of the class of phenylethanolamines that is catechol substituted at position 5 by a 2-(tert-butylamino)-1-hydroxyethyl group. |
|
| formula |
C12H19NO3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35524 http://purl.obolibrary.org/obo/CHEBI_35526 http://purl.obolibrary.org/obo/CHEBI_38462 http://purl.obolibrary.org/obo/CHEBI_66993 http://purl.obolibrary.org/obo/CHEBI_35522 |
|
| has_exact_synonym |
5-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,3-diol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
terbutalinum terbutaline terbutalina |
|
| id |
CHEBI:9449 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H19NO3/c1-12(2,3)13-7-11(16)8-4-9(14)6-10(15)5-8/h4-6,11,13-16H,7H2,1-3H3 |
|
| inchikey |
XWTYSIMOBUGWOL-UHFFFAOYSA-N |
|
| label |
terbutaline |
|
| mass |
225.28420 |
|
| monoisotopicmass |
225.13649 |
|
| notation |
CHEBI:9449 |
|
| prefLabel |
terbutaline |
|
| smiles |
CC(C)(C)NCC(O)c1cc(O)cc(O)c1 |
|
| treeView | ||
| subClassOf |