loading...| Preferred Name | tamsulosin hydrochloride | |
| Synonyms |
Pradif R-(-)-5-(2-((2-(2-ethoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide hydrochloride Harnal Flomax LY253351 (-)-(R)-5-(2-((2-(o-ethoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide monohydrochloride YM 617 (R)-5-(2-((2-(2-ethoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide monohydrochloride Omnic 5-[(2R)-2-{[2-(2-ethoxyphenoxy)ethyl]amino}propyl]-2-methoxybenzenesulfonamide hydrochloride |
|
| Definitions |
A hydrochloride resulting from the reaction of equimolar amounts of tamulosin and hydrogen chloride. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9399 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:6897600 DrugBank:DB00706 Drug_Central:2562 KEGG:D01024 CAS:106463-17-6 Patent:WO2007031823 |
|
| definition |
A hydrochloride resulting from the reaction of equimolar amounts of tamulosin and hydrogen chloride. |
|
| formula |
C20H28N2O5S.HCl C20H29ClN2O5S |
|
| has part | ||
| has role | ||
| has_exact_synonym |
5-[(2R)-2-{[2-(2-ethoxyphenoxy)ethyl]amino}propyl]-2-methoxybenzenesulfonamide hydrochloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Pradif R-(-)-5-(2-((2-(2-ethoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide hydrochloride Harnal Flomax LY253351 (-)-(R)-5-(2-((2-(o-ethoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide monohydrochloride YM 617 (R)-5-(2-((2-(2-ethoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide monohydrochloride Omnic |
|
| id |
CHEBI:9399 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H28N2O5S.ClH/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24;/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24);1H/t15-;/m1./s1 |
|
| inchikey |
ZZIZZTHXZRDOFM-XFULWGLBSA-N |
|
| is enantiomer of | ||
| label |
tamsulosin hydrochloride |
|
| mass |
444.974 |
|
| monoisotopicmass |
444.14857 |
|
| notation |
CHEBI:9399 |
|
| prefLabel |
tamsulosin hydrochloride |
|
| smiles |
C=1C=C(OCCN[C@@H](CC2=CC=C(C(=C2)S(N)(=O)=O)OC)C)C(=CC1)OCC.Cl |
|
| treeView | ||
| subClassOf |