Preferred Name |
triprolidine |
|
Synonyms |
2-[(1E)-1-(4-methylphenyl)-3-(pyrrolidin-1-yl)prop-1-en-1-yl]pyridine tripolidina trans-2-(3-(1-pyrrolidinyl)-1-p-tolylpropenyl)pyridine triprolidine (E)-2-[3-(1-pyrrolidinyl)-1-p-toluenepropenyl]pyridine triprolidinum trans-1-(4-methylphenyl)-1-(2-pyridyl)-3-pyrrolidinoprop-1-ene trans-1-(2-pyridyl)-3-pyrrolidino-1-p-tolylprop-1-ene |
|
Definitions |
An N-alkylpyrrolidine that is acrivastine in which the pyridine ring is lacking the propenoic acid substituent. It is a sedating antihistamine that is used (generally as the monohydrochloride monohydrate) for the relief of the symptoms of uticaria, rhinitis, and various pruritic skin disorders. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_84116 |
|
charge |
0 |
|
database_cross_reference |
PMID:1362948 CAS:486-12-4 PMID:6509877 Drug_Central:2763 PMID:7258744 PMID:3944383 PMID:1362947 Patent:US2712023 Reaxys:87215 HMDB:HMDB0014571 DrugBank:DB00427 PMID:8529817 Wikipedia:Triprolidine KEGG:D08648 Patent:US2712020 |
|
definition |
An N-alkylpyrrolidine that is acrivastine in which the pyridine ring is lacking the propenoic acid substituent. It is a sedating antihistamine that is used (generally as the monohydrochloride monohydrate) for the relief of the symptoms of uticaria, rhinitis, and various pruritic skin disorders. |
|
formula |
C19H22N2 |
|
has role | ||
has_exact_synonym |
2-[(1E)-1-(4-methylphenyl)-3-(pyrrolidin-1-yl)prop-1-en-1-yl]pyridine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
tripolidina trans-2-(3-(1-pyrrolidinyl)-1-p-tolylpropenyl)pyridine triprolidine (E)-2-[3-(1-pyrrolidinyl)-1-p-toluenepropenyl]pyridine triprolidinum trans-1-(4-methylphenyl)-1-(2-pyridyl)-3-pyrrolidinoprop-1-ene trans-1-(2-pyridyl)-3-pyrrolidino-1-p-tolylprop-1-ene |
|
id |
CHEBI:84116 |
|
in_subset | ||
inchi |
InChI=1S/C19H22N2/c1-16-7-9-17(10-8-16)18(19-6-2-3-12-20-19)11-15-21-13-4-5-14-21/h2-3,6-12H,4-5,13-15H2,1H3/b18-11+ |
|
inchikey |
CBEQULMOCCWAQT-WOJGMQOQSA-N |
|
is conjugate base of | ||
label |
triprolidine |
|
mass |
278.39140 |
|
monoisotopicmass |
278.17830 |
|
notation |
CHEBI:84116 |
|
prefLabel |
triprolidine |
|
smiles |
Cc1ccc(cc1)C(=C/CN1CCCC1)\c1ccccn1 |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_78840 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_78840 |