Preferred Name |
pramocaine |
|
Synonyms |
4-[3-(4-butoxyphenoxy)propyl]morpholine Pramocaine Pramoxine pramocainum p-butoxyphenyl gamma-morpholinopropyl ether gamma-morpholinopropyl 4-n-butoxyphenyl ether proxazocain |
|
Definitions |
A member of the class of morpholines that is morpholine substituted at the nitrogen atom by a 3-(4-butoxyphenoxy)propyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8357 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:239059 PMID:17244091 KEGG:C07892 PMID:8150879 Drug_Central:3487 Wikipedia:Pramocaine KEGG:D08407 LINCS:LSM-5573 CAS:140-65-8 Beilstein:239059 PMID:24819289 |
|
definition |
A member of the class of morpholines that is morpholine substituted at the nitrogen atom by a 3-(4-butoxyphenoxy)propyl group. |
|
formula |
C17H27NO3 |
|
has role | ||
has_exact_synonym |
4-[3-(4-butoxyphenoxy)propyl]morpholine Pramocaine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Pramoxine pramocainum p-butoxyphenyl gamma-morpholinopropyl ether gamma-morpholinopropyl 4-n-butoxyphenyl ether proxazocain |
|
id |
CHEBI:8357 |
|
in_subset | ||
inchi |
InChI=1S/C17H27NO3/c1-2-3-12-20-16-5-7-17(8-6-16)21-13-4-9-18-10-14-19-15-11-18/h5-8H,2-4,9-15H2,1H3 |
|
inchikey |
DQKXQSGTHWVTAD-UHFFFAOYSA-N |
|
label |
pramocaine |
|
mass |
293.40122 |
|
monoisotopicmass |
293.19909 |
|
notation |
CHEBI:8357 |
|
prefLabel |
pramocaine |
|
smiles |
CCCCOc1ccc(OCCCN2CCOCC2)cc1 |
|
treeView | ||
subClassOf |