Preferred Name |
pemoline |
|
Synonyms |
Myamin Dantromin Hyton 2-Amino-5-phenyl-4(5H)-oxazolone Betanamin pemolinum Nitan phenylpseudohydantoin 5-phenyl-2-imino-4-oxooxazolidine 5-phenylisohydantion Deltamine pheniminooxazolidinone 5-phenyl-2-imino-4-oxazolidinone 2-imino-4-keto-5-phenyltetrahydrooxazole 2-imino-5-phenyl-4-oxazolidinone Cylert pemoline Azoxodon Notair phenylisohydantoin pemolina 2-amino-5-phenyl-1,3-oxazol-4(5H)-one |
|
Definitions |
A member of the class of 1,3-oxazoles that is 1,3-oxazol-4(5H)-one which is substituted by an amino group at position 2 and by a phenyl group at position 5. A central nervous system stimulant, it was used to treat hyperactivity disorders in children, but withdrawn from use following reports of serious hepatotoxicity. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7953 |
|
charge |
0 |
|
database_cross_reference |
PMID:641739 LINCS:LSM-5159 Drug_Central:2075 PMID:772696 PMID:2210262 PMID:4021028 PMID:11216184 KEGG:C07899 PMID:2388127 KEGG:D00744 PMID:2303976 CAS:2152-34-3 DrugBank:DB01230 Wikipedia:Pemoline Reaxys:151559 |
|
definition |
A member of the class of 1,3-oxazoles that is 1,3-oxazol-4(5H)-one which is substituted by an amino group at position 2 and by a phenyl group at position 5. A central nervous system stimulant, it was used to treat hyperactivity disorders in children, but withdrawn from use following reports of serious hepatotoxicity. |
|
formula |
C9H8N2O2 |
|
has role | ||
has_exact_synonym |
2-amino-5-phenyl-1,3-oxazol-4(5H)-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Myamin Dantromin Hyton 2-Amino-5-phenyl-4(5H)-oxazolone Betanamin pemolinum Nitan phenylpseudohydantoin 5-phenyl-2-imino-4-oxooxazolidine 5-phenylisohydantion Deltamine pheniminooxazolidinone 5-phenyl-2-imino-4-oxazolidinone 2-imino-4-keto-5-phenyltetrahydrooxazole 2-imino-5-phenyl-4-oxazolidinone Cylert pemoline Azoxodon Notair phenylisohydantoin pemolina |
|
id |
CHEBI:7953 |
|
in_subset | ||
inchi |
InChI=1S/C9H8N2O2/c10-9-11-8(12)7(13-9)6-4-2-1-3-5-6/h1-5,7H,(H2,10,11,12) |
|
inchikey |
NRNCYVBFPDDJNE-UHFFFAOYSA-N |
|
label |
pemoline |
|
mass |
176.17200 |
|
monoisotopicmass |
176.05858 |
|
notation |
CHEBI:7953 |
|
prefLabel |
pemoline |
|
smiles |
NC1=NC(=O)C(O1)c1ccccc1 |
|
treeView | ||
subClassOf |