loading...| Preferred Name | oxiconazole nitrate | |
| Synonyms |
Oxistat Myfungar Oceral ST 813 1-[(2Z)-2-{[(2,4-dichlorobenzyl)oxy]imino}-2-(2,4-dichlorophenyl)ethyl]-1H-imidazol-3-ium nitrate 2',4'-dichloro-2-imidazol-1-ylacetophenone (Z)-[OO-(2,4-dichlorobenzyl)oxime] mononitrate ST-813 Ro 13-8996 (1Z)-N-[(2,4-dichlorobenzyl)oxy]-1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethanimine nitrate |
|
| Definitions |
An organic nitrate salt resulting from the reaction of equimolar amounts of oxiconazole and nitric acid. An antifungal agent, it is used in creams and powders for the topical treatment of fungal skin infections. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7826 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:US4124767 HMDB:HMDB0014384 KEGG:C08075 DrugBank:DB00239 CAS:64211-46-7 KEGG:D00885 Reaxys:6042368 Patent:DE2657578 |
|
| definition |
An organic nitrate salt resulting from the reaction of equimolar amounts of oxiconazole and nitric acid. An antifungal agent, it is used in creams and powders for the topical treatment of fungal skin infections. |
|
| formula |
C18H14Cl4N4O4 C18H13Cl4N3O.HNO3 |
|
| has part | ||
| has role | ||
| has_exact_synonym |
(1Z)-N-[(2,4-dichlorobenzyl)oxy]-1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethanimine nitrate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Oxistat Myfungar Oceral ST 813 1-[(2Z)-2-{[(2,4-dichlorobenzyl)oxy]imino}-2-(2,4-dichlorophenyl)ethyl]-1H-imidazol-3-ium nitrate 2',4'-dichloro-2-imidazol-1-ylacetophenone (Z)-[OO-(2,4-dichlorobenzyl)oxime] mononitrate ST-813 Ro 13-8996 |
|
| id |
CHEBI:7826 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H13Cl4N3O.HNO3/c19-13-2-1-12(16(21)7-13)10-26-24-18(9-25-6-5-23-11-25)15-4-3-14(20)8-17(15)22;2-1(3)4/h1-8,11H,9-10H2;(H,2,3,4)/b24-18+; |
|
| inchikey |
WVNOAGNOIPTWPT-NDUABGMUSA-N |
|
| label |
oxiconazole nitrate |
|
| mass |
492.14000 |
|
| monoisotopicmass |
489.97692 |
|
| notation |
CHEBI:7826 |
|
| prefLabel |
oxiconazole nitrate |
|
| smiles |
O[N+]([O-])=O.Clc1ccc(CO\N=C(/Cn2ccnc2)c2ccc(Cl)cc2Cl)c(Cl)c1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_87069 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_87069 |