loading...| Preferred Name |
dolutegravir sodium |
|
| Synonyms |
sodium (4R,12aS)-9-[(2,4-difluorobenzyl)carbamoyl]-4-methyl-6,8-dioxo-3,4,6,8,12,12a-hexahydro-2H-pyrido[1',2':4,5]pyrazino[2,1-b][1,3]oxazin-7-olate GSK 1349572A Tivicay GSK1349572A |
|
| Definitions |
An organic sodium salt that is the monosodium salt of dolutegravir. Used for treatment of HIV-1. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_76007 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:24081387 CAS:1051375-19-9 Reaxys:20386344 KEGG:D10113 Wikipedia:Dolutegravir |
|
| definition |
An organic sodium salt that is the monosodium salt of dolutegravir. Used for treatment of HIV-1. |
|
| formula |
C20H18F2N3NaO5 |
|
| has part | ||
| has role | ||
| has_exact_synonym |
sodium (4R,12aS)-9-[(2,4-difluorobenzyl)carbamoyl]-4-methyl-6,8-dioxo-3,4,6,8,12,12a-hexahydro-2H-pyrido[1',2':4,5]pyrazino[2,1-b][1,3]oxazin-7-olate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
GSK 1349572A Tivicay GSK1349572A |
|
| id |
CHEBI:76007 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H19F2N3O5.Na/c1-10-4-5-30-15-9-24-8-13(17(26)18(27)16(24)20(29)25(10)15)19(28)23-7-11-2-3-12(21)6-14(11)22;/h2-3,6,8,10,15,27H,4-5,7,9H2,1H3,(H,23,28);/q;+1/p-1/t10-,15+;/m1./s1 |
|
| inchikey |
UGWJRRXTMKRYNK-VSLILLSYSA-M |
|
| label |
dolutegravir sodium |
|
| mass |
441.36060 |
|
| monoisotopicmass |
441.11122 |
|
| notation |
CHEBI:76007 |
|
| prefLabel |
dolutegravir sodium |
|
| smiles |
[Na+].C[C@@H]1CCO[C@H]2Cn3cc(C(=O)NCc4ccc(F)cc4F)c(=O)c([O-])c3C(=O)N12 |
|
| treeView | ||
| subClassOf |