loading...| Preferred Name |
naproxen sodium |
|
| Synonyms |
sodium (2S)-2-(6-methoxy-2-naphthyl)propanoate (-)-Sodium (S)-6-methoxy-alpha-methyl-2-naphthaleneacetate |
|
| Definitions |
An organic sodium salt consisting of equimolar amounts of naproxen(1-) anions and sodium anions. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7477 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:26159-34-2 DrugBank:DB00788 Beilstein:6378035 KEGG:D00970 |
|
| definition |
An organic sodium salt consisting of equimolar amounts of naproxen(1-) anions and sodium anions. |
|
| formula |
C14H13NaO3 C14H13O3.Na |
|
| has part | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35493 http://purl.obolibrary.org/obo/CHEBI_50629 http://purl.obolibrary.org/obo/CHEBI_35475 |
|
| has_exact_synonym |
sodium (2S)-2-(6-methoxy-2-naphthyl)propanoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(-)-Sodium (S)-6-methoxy-alpha-methyl-2-naphthaleneacetate |
|
| id |
CHEBI:7477 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H14O3.Na/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10;/h3-9H,1-2H3,(H,15,16);/q;+1/p-1/t9-;/m0./s1 |
|
| inchikey |
CDBRNDSHEYLDJV-FVGYRXGTSA-M |
|
| label |
naproxen sodium |
|
| mass |
252.24100 |
|
| monoisotopicmass |
252.07624 |
|
| notation |
CHEBI:7477 |
|
| prefLabel |
naproxen sodium |
|
| smiles |
[Na+].COc1ccc2cc(ccc2c1)[C@H](C)C([O-])=O |
|
| treeView | ||
| subClassOf |