loading...| Preferred Name | naltrexone | |
| Synonyms |
naltrexone N-Cyclopropylmethylnoroxymorphone 17-(Cyclopropylmethyl)-4,5-epoxy-3,14-dihydroxymorphinan-6-one 17-(Cyclopropylmethyl)-4,5alpha-epoxy-3,14-dihydroxymorphinan-6-one N-Cyclopropylmethyl-14-hydroxydihydromorphinone Naltrexone 3,14-dihydroxy-17-(cyclopropylmethyl)-4,5alpha-epoxymorphinan-6-one |
|
| Definitions |
An organic heteropentacyclic compound that is naloxone substituted in which the allyl group attached to the nitrogen is replaced by a cyclopropylmethyl group. A mu-opioid receptor antagonist, it is used to treat alcohol dependence. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7465 |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:1765 PMID:27690505 PMID:24107112 PMID:28118565 PMID:28011389 PMID:28184294 PMID:28153651 PMID:17023477 Reaxys:3596648 PMID:28168894 PMID:28068780 PMID:27787292 PMID:27700187 PMID:27936293 PMID:28044452 Patent:US3332950 Wikipedia:Naltrexone PMID:28144772 PMID:28061017 PMID:28029718 PMID:24659754 DrugBank:DB00704 PMID:28130024 PMID:27813192 PMID:27987236 HMDB:HMDB0014842 KEGG:C07253 CAS:16590-41-3 PMID:27875802 PMID:28161142 KEGG:D05113 PMID:28106937 LINCS:LSM-3962 PMID:27922226 |
|
| definition |
An organic heteropentacyclic compound that is naloxone substituted in which the allyl group attached to the nitrogen is replaced by a cyclopropylmethyl group. A mu-opioid receptor antagonist, it is used to treat alcohol dependence. |
|
| formula |
C20H23NO4 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_90755 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_50137 |
|
| has_exact_synonym |
Naltrexone 3,14-dihydroxy-17-(cyclopropylmethyl)-4,5alpha-epoxymorphinan-6-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
naltrexone N-Cyclopropylmethylnoroxymorphone 17-(Cyclopropylmethyl)-4,5-epoxy-3,14-dihydroxymorphinan-6-one 17-(Cyclopropylmethyl)-4,5alpha-epoxy-3,14-dihydroxymorphinan-6-one N-Cyclopropylmethyl-14-hydroxydihydromorphinone |
|
| id |
CHEBI:7465 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H23NO4/c22-13-4-3-12-9-15-20(24)6-5-14(23)18-19(20,16(12)17(13)25-18)7-8-21(15)10-11-1-2-11/h3-4,11,15,18,22,24H,1-2,5-10H2/t15-,18+,19+,20-/m1/s1 |
|
| inchikey |
DQCKKXVULJGBQN-XFWGSAIBSA-N |
|
| is conjugate base of | ||
| label |
naltrexone |
|
| mass |
341.40096 |
|
| monoisotopicmass |
341.16271 |
|
| notation |
CHEBI:7465 |
|
| prefLabel |
naltrexone |
|
| smiles |
Oc1ccc2C[C@H]3N(CC[C@@]45[C@@H](Oc1c24)C(=O)CC[C@@]35O)CC1CC1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_51454 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_51454 |