Preferred Name |
iodoacetic acid |
|
Synonyms |
iodoacetic acid ICH2COOH CH2ICO2H CH2ICOOH 2-iodoacetic acid monoiodoacetic acid iodoethanoic acid ICH2CO2H |
|
Definitions |
A haloacetic acid that is acetic acid in which one of the hydrogens of the methyl group is replaced by an iodine atom. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_74571 |
|
charge |
0 |
|
database_cross_reference |
PMID:23657794 PMID:23613747 CAS:64-69-7 PMID:22206935 LIPID_MAPS_instance:LMFA01090135 LINCS:LSM-5944 Wikipedia:Iodoacetic_acid PMID:23641915 PMID:22562395 PMID:22251455 Reaxys:1739079 PMID:21740901 |
|
definition |
A haloacetic acid that is acetic acid in which one of the hydrogens of the methyl group is replaced by an iodine atom. |
|
formula |
C2H3IO2 |
|
has role | ||
has_exact_synonym |
iodoacetic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
ICH2COOH CH2ICO2H CH2ICOOH 2-iodoacetic acid monoiodoacetic acid iodoethanoic acid ICH2CO2H |
|
id |
CHEBI:74571 |
|
in_subset | ||
inchi |
InChI=1S/C2H3IO2/c3-1-2(4)5/h1H2,(H,4,5) |
|
inchikey |
JDNTWHVOXJZDSN-UHFFFAOYSA-N |
|
label |
iodoacetic acid |
|
mass |
185.94850 |
|
monoisotopicmass |
185.91777 |
|
notation |
CHEBI:74571 |
|
prefLabel |
iodoacetic acid |
|
smiles |
OC(=O)CI |
|
treeView | ||
subClassOf |