loading...| Preferred Name |
6-aminonicotinamide |
|
| Synonyms |
6-amino-3-pyridinecarboxamide 6-aminonicotinic acid amide 2-amino-5-carbamoylpyridine SR 4388 6-AN 6-Aminonikotinsaeureamid 6-ANA 6-aminonicotinamide |
|
| Definitions |
A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 6-aminonicotinic acid with ammonia. An inhibitor of the NADP(+)-dependent enzyme, 6-phosphogluconate dehydrogenase, it interferes with glycolysis, resulting in ATP depletion and synergizes with DNA-crosslinking chemotherapy drugs, such as cisplatin, in killing cancer cells. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_74514 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:329-89-5 PMID:9516960 MetaCyc:CPD-9571 PMID:152349 PMID:6236288 PMID:2948367 PMID:125068 PMID:3156443 PMID:6445393 PMID:155198 PMID:145497 Reaxys:116042 |
|
| definition |
A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 6-aminonicotinic acid with ammonia. An inhibitor of the NADP(+)-dependent enzyme, 6-phosphogluconate dehydrogenase, it interferes with glycolysis, resulting in ATP depletion and synergizes with DNA-crosslinking chemotherapy drugs, such as cisplatin, in killing cancer cells. |
|
| formula |
C6H7N3O |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_50905 |
|
| has_exact_synonym |
6-aminonicotinamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
6-amino-3-pyridinecarboxamide 6-aminonicotinic acid amide 2-amino-5-carbamoylpyridine SR 4388 6-AN 6-Aminonikotinsaeureamid 6-ANA |
|
| id |
CHEBI:74514 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H7N3O/c7-5-2-1-4(3-9-5)6(8)10/h1-3H,(H2,7,9)(H2,8,10) |
|
| inchikey |
ZLWYEPMDOUQDBW-UHFFFAOYSA-N |
|
| label |
6-aminonicotinamide |
|
| mass |
137.13930 |
|
| monoisotopicmass |
137.05891 |
|
| notation |
CHEBI:74514 |
|
| prefLabel |
6-aminonicotinamide |
|
| smiles |
NC(=O)c1ccc(N)nc1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_50994 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50994 |