loading...| Preferred Name |
gadoterate meglumine |
|
| Synonyms |
1-deoxy-1-(methylazaniumyl)-D-glucitol [2,2',2'',2'''-(1,4,7,10-tetraazacyclododecane-1,4,7,10-tetrayl-kappa(4)N(1),N(4),N(7),N(10))tetraacetato(4-)]gadolinate(1-) [2,2',2'',2'''-(1,4,7,10-tetraazacyclododecane-1,4,7,10-tetrayl-kappa(4)N(1),N(4),N(7),N(10))tetraacetato(3-)]gadolinium--1-deoxy-1-(methylamino)-D-glucitol (1/1) Meglumine gadopentate Gadolinium-DOTA meglumine Gd-DOTA meglumine Meglumine gadoterate |
|
| Definitions |
An organoammonium salt obtained by reaction of gadoteric acid with one equivalent of 1-deoxy-1-(methylamino)-D-glucitol (meglumine). It is used in magnetic resonance imaging (MRI) in brain (intracranial), spine and associated tissues of patients ages 2 years and older, to detect and visualise areas with disruption of the blood brain barrier and/or abnormal vascularity of the central nervous system. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_73727 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:21339348 PMID:22344402 PMID:22578838 PMID:22109336 PMID:22772150 PMID:22543971 PMID:23262793 PMID:21577130 PMID:22592612 PMID:23211552 PMID:23297321 PMID:20407903 KEGG:D03355 Wikipedia:Gadoteric_acid PMID:21904991 PMID:22167518 CAS:92943-93-6 PMID:21890295 PMID:23212275 PMID:21045181 PMID:22068227 |
|
| definition |
An organoammonium salt obtained by reaction of gadoteric acid with one equivalent of 1-deoxy-1-(methylamino)-D-glucitol (meglumine). It is used in magnetic resonance imaging (MRI) in brain (intracranial), spine and associated tissues of patients ages 2 years and older, to detect and visualise areas with disruption of the blood brain barrier and/or abnormal vascularity of the central nervous system. |
|
| formula |
C23H42GdN5O13 |
|
| has part | ||
| has role | ||
| has_exact_synonym |
1-deoxy-1-(methylazaniumyl)-D-glucitol [2,2',2'',2'''-(1,4,7,10-tetraazacyclododecane-1,4,7,10-tetrayl-kappa(4)N(1),N(4),N(7),N(10))tetraacetato(4-)]gadolinate(1-) [2,2',2'',2'''-(1,4,7,10-tetraazacyclododecane-1,4,7,10-tetrayl-kappa(4)N(1),N(4),N(7),N(10))tetraacetato(3-)]gadolinium--1-deoxy-1-(methylamino)-D-glucitol (1/1) |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Meglumine gadopentate Gadolinium-DOTA meglumine Gd-DOTA meglumine Meglumine gadoterate |
|
| id |
CHEBI:73727 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H28N4O8.C7H17NO5.Gd/c21-13(22)9-17-1-2-18(10-14(23)24)5-6-20(12-16(27)28)8-7-19(4-3-17)11-15(25)26;1-8-2-4(10)6(12)7(13)5(11)3-9;/h1-12H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28);4-13H,2-3H2,1H3;/q;;+3/p-3/t;4-,5+,6+,7+;/m.0./s1 |
|
| inchikey |
RYHQMKVRYNEBNJ-BMWGJIJESA-K |
|
| label |
gadoterate meglumine |
|
| mass |
753.86000 |
|
| monoisotopicmass |
754.20202 |
|
| notation |
CHEBI:73727 |
|
| prefLabel |
gadoterate meglumine |
|
| smiles |
CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.OC(=O)C[N+]12CC[N+]3(CC[N+]4(CC[N+](CC1)(CC([O-])=O)[Gd-]234)CC([O-])=O)CC([O-])=O |
|
| treeView | ||
| subClassOf |