loading...| Preferred Name | eribulin mesylate | |
| Synonyms |
E 7389 Halaven E7389 Eribulin mesilate 2-(3-amino-2-hydroxypropyl)hexacosahydro-3-methoxy-26-methyl-20,27-bis(methylene)11,15-18,21-24,28-triepoxy-7,9-ethano-12,15-methano-9H,15H-furo(3,2-i)furo(2',3'-5,6)pyrano(4,3-b)(1,4)dioxacyclopentacosin-5-(4H)-one methanesulfonate |
|
| Definitions |
A methanesulfonate salt obtained by reaction of eribulin with one equivalent of methanesulfonic acid. A fully synthetic macrocyclic ketone analogue of marine sponge natural products. Inhibits growth phase of microtubules via tubulin-based antimitotic mechanism, which leads to G2/M cell-cycle block, disruption of mitotic spindles, and, ultimately, apoptotic cell death after prolonged mitotic blockage. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_70710 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22803519 PMID:22198425 PMID:22162924 PMID:22694309 PMID:21989327 PMID:23010853 PMID:22291464 PMID:22514495 KEGG:D08914 PMID:21935916 PMID:22619477 PMID:22517020 PMID:22739019 Reaxys:11271529 PMID:22282463 PMID:22829199 PMID:21862415 PMID:22593439 PMID:21526355 PMID:21375468 PMID:21550727 PMID:22555773 PMID:22953094 PMID:21903605 PMID:22216781 CAS:441045-17-6 PMID:21887501 |
|
| definition |
A methanesulfonate salt obtained by reaction of eribulin with one equivalent of methanesulfonic acid. A fully synthetic macrocyclic ketone analogue of marine sponge natural products. Inhibits growth phase of microtubules via tubulin-based antimitotic mechanism, which leads to G2/M cell-cycle block, disruption of mitotic spindles, and, ultimately, apoptotic cell death after prolonged mitotic blockage. |
|
| formula |
C41H63NO14S |
|
| has part | ||
| has role | ||
| has_exact_synonym |
2-(3-amino-2-hydroxypropyl)hexacosahydro-3-methoxy-26-methyl-20,27-bis(methylene)11,15-18,21-24,28-triepoxy-7,9-ethano-12,15-methano-9H,15H-furo(3,2-i)furo(2',3'-5,6)pyrano(4,3-b)(1,4)dioxacyclopentacosin-5-(4H)-one methanesulfonate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
E 7389 Halaven E7389 Eribulin mesilate |
|
| id |
CHEBI:70710 |
|
| in_subset | ||
| inchi |
InChI=1S/C40H59NO11.CH4O3S/c1-19-11-24-5-7-28-20(2)12-26(45-28)9-10-40-17-33-36(51-40)37-38(50-33)39(52-40)35-29(49-37)8-6-25(47-35)13-22(42)14-27-31(16-30(46-24)21(19)3)48-32(34(27)44-4)15-23(43)18-41;1-5(2,3)4/h19,23-39,43H,2-3,5-18,41H2,1,4H3;1H3,(H,2,3,4)/t19-,23+,24+,25-,26+,27+,28+,29+,30-,31+,32-,33-,34-,35+,36+,37+,38-,39+,40+;/m1./s1 |
|
| inchikey |
QAMYWGZHLCQOOJ-WRNBYXCMSA-N |
|
| label |
eribulin mesylate |
|
| mass |
826.00200 |
|
| monoisotopicmass |
825.39693 |
|
| notation |
CHEBI:70710 |
|
| prefLabel |
eribulin mesylate |
|
| smiles |
CS(O)(=O)=O.[H][C@@]12CC[C@]3([H])O[C@@]([H])(CC[C@@]45C[C@]6([H])O[C@]7([H])[C@@]([H])(O[C@@]8([H])CC[C@]([H])(CC(=O)C[C@]9([H])[C@@H](OC)[C@@H](C[C@H](O)CN)O[C@@]9([H])C[C@@]([H])(O1)C(=C)[C@H](C)C2)O[C@]8([H])[C@]7([H])O4)[C@H]6O5)CC3=C |
|
| treeView | ||
| subClassOf |