loading...| Preferred Name |
moricizine |
|
| Synonyms |
EN-313 moracizinum [10-(3-Morpholin-4-yl-propionyl)-10H-phenothiazin-2-yl]-carbamic acid ethyl ester ethyl 10-(beta-N-morpholinylpropionyl)phenothiazine-2-carbamate moracizine moracizina ethyl 10-(3-morpholinopropionyl)phenothiazine-2-carbamate Moricizine ethyl {10-[3-(morpholin-4-yl)propanoyl]-10H-phenothiazin-2-yl}carbamate |
|
| Definitions |
A phenothiazine substituted on the nitrogen by a 3-(morpholin-4-yl)propanoyl group, and at position 2 by an (ethoxycarbonyl)amino group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6997 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Moricizine Patent:DE2014201 DrugBank:DB00680 CAS:31883-05-3 KEGG:D05077 Reaxys:592021 KEGG:C07743 Patent:US3740395 LINCS:LSM-2476 Drug_Central:1842 |
|
| definition |
A phenothiazine substituted on the nitrogen by a 3-(morpholin-4-yl)propanoyl group, and at position 2 by an (ethoxycarbonyl)amino group. |
|
| formula |
C22H25N3O4S |
|
| has role | ||
| has_alternative_id |
CHEBI:239866 |
|
| has_exact_synonym |
Moricizine ethyl {10-[3-(morpholin-4-yl)propanoyl]-10H-phenothiazin-2-yl}carbamate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
EN-313 moracizinum [10-(3-Morpholin-4-yl-propionyl)-10H-phenothiazin-2-yl]-carbamic acid ethyl ester ethyl 10-(beta-N-morpholinylpropionyl)phenothiazine-2-carbamate moracizine moracizina ethyl 10-(3-morpholinopropionyl)phenothiazine-2-carbamate |
|
| id |
CHEBI:6997 |
|
| in_subset | ||
| inchi |
InChI=1S/C22H25N3O4S/c1-2-29-22(27)23-16-7-8-20-18(15-16)25(17-5-3-4-6-19(17)30-20)21(26)9-10-24-11-13-28-14-12-24/h3-8,15H,2,9-14H2,1H3,(H,23,27) |
|
| inchikey |
FUBVWMNBEHXPSU-UHFFFAOYSA-N |
|
| label |
moricizine |
|
| mass |
427.51700 |
|
| monoisotopicmass |
427.15658 |
|
| notation |
CHEBI:6997 |
|
| prefLabel |
moricizine |
|
| smiles |
CCOC(=O)Nc1ccc2Sc3ccccc3N(C(=O)CCN3CCOCC3)c2c1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_38093 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38093 |