loading...| Preferred Name |
deferiprone |
|
| Synonyms |
1,2-Dimethyl-3-hydroxypyrid-4-one 3-Hydroxy-1,2-dimethyl-4(1H)-pyridone Ferriprox deferiprone 3-hydroxy-1,2-dimethylpyridin-4(1H)-one |
|
| Definitions |
A member of the class of 4-pyridones that is pyridin-4(1H)-one substituted at positions 1 and 2 by methyl groups and at position 3 by a hydroxy group. A lipid-soluble iron-chelator used for treatment of thalassaemia. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_68554 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22180427 PMID:22621771 PMID:22130677 CAS:30652-11-0 PMID:22978744 PMID:22454828 PMID:22943064 PMID:22565013 Drug_Central:4188 PMID:22171759 PMID:22664119 PMID:22354281 Reaxys:1447108 Wikipedia:Deferiprone PMID:22759897 PMID:22034002 PMID:22622672 PMID:22459459 PMID:22457166 PMID:22468647 KEGG:D07416 PMID:21853518 PMID:22579919 PMID:22277065 PMID:22572843 Beilstein:1447108 PMID:22406440 PMID:22850524 PMID:22025507 LINCS:LSM-36972 |
|
| definition |
A member of the class of 4-pyridones that is pyridin-4(1H)-one substituted at positions 1 and 2 by methyl groups and at position 3 by a hydroxy group. A lipid-soluble iron-chelator used for treatment of thalassaemia. |
|
| formula |
C7H9NO2 |
|
| has role | ||
| has_exact_synonym |
3-hydroxy-1,2-dimethylpyridin-4(1H)-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1,2-Dimethyl-3-hydroxypyrid-4-one 3-Hydroxy-1,2-dimethyl-4(1H)-pyridone Ferriprox deferiprone |
|
| id |
CHEBI:68554 |
|
| in_subset | ||
| inchi |
InChI=1S/C7H9NO2/c1-5-7(10)6(9)3-4-8(5)2/h3-4,10H,1-2H3 |
|
| inchikey |
TZXKOCQBRNJULO-UHFFFAOYSA-N |
|
| label |
deferiprone |
|
| mass |
139.15190 |
|
| monoisotopicmass |
139.06333 |
|
| notation |
CHEBI:68554 |
|
| prefLabel |
deferiprone |
|
| smiles |
Cc1c(O)c(=O)ccn1C |
|
| treeView | ||
| subClassOf |