loading...| Preferred Name |
methohexital sodium |
|
| Synonyms |
sodium 5-(hex-3-yn-2-yl)-1-methyl-4,6-dioxo-5-(prop-2-en-1-yl)-1,4,5,6-tetrahydropyrimidin-2-olate sodium methohexital sodium 5-allyl-1-methyl-5-(1-methyl-2- pentynyl)barbiturate Brevital sodium methohexitone sodium Brietal Sodium Brevital |
|
| Definitions |
The sodium salt of methohexital. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6834 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB00474 KEGG:D00712 Reaxys:4284264 Patent:US2872448 CAS:309-36-4 |
|
| definition |
The sodium salt of methohexital. |
|
| formula |
C14H17N2NaO3 |
|
| has part | ||
| has role | ||
| has_exact_synonym |
sodium 5-(hex-3-yn-2-yl)-1-methyl-4,6-dioxo-5-(prop-2-en-1-yl)-1,4,5,6-tetrahydropyrimidin-2-olate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
sodium methohexital sodium 5-allyl-1-methyl-5-(1-methyl-2- pentynyl)barbiturate Brevital sodium methohexitone sodium Brietal Sodium Brevital |
|
| id |
CHEBI:6834 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H18N2O3.Na/c1-5-7-8-10(3)14(9-6-2)11(17)15-13(19)16(4)12(14)18;/h6,10H,2,5,9H2,1,3-4H3,(H,15,17,19);/q;+1/p-1 |
|
| inchikey |
KDXZREBVGAGZHS-UHFFFAOYSA-M |
|
| label |
methohexital sodium |
|
| mass |
284.28610 |
|
| monoisotopicmass |
284.11369 |
|
| notation |
CHEBI:6834 |
|
| prefLabel |
methohexital sodium |
|
| smiles |
[Na+].CCC#CC(C)C1(CC=C)C(=O)N=C([O-])N(C)C1=O |
|
| treeView | ||
| subClassOf |