loading...| Preferred Name | mesalamine | |
| Synonyms |
3-carboxy-4-hydroxyaniline Mesasal Salofalk Fisalamine 5-Aminosalicylic acid Claversal mesalazina Pentasa Asacol Canasa mesalazinum mesalazine Asacolitin Mesalazine Rowasa m-Aminosalicylic acid p-Aminosalicylsaeure Iialda Lixacol 5-ASA 5-amino-2-hydroxybenzoic acid |
|
| Definitions |
A monohydroxybenzoic acid that is salicylic acid substituted by an amino group at the 5-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6775 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23137838 HMDB:HMDB0014389 PMID:28166217 Drug_Central:1710 KEGG:D00377 PMID:22648999 PMID:23146664 DrugBank:DB00244 LINCS:LSM-5427 PMID:22304735 Wikipedia:Mesalamine CAS:89-57-6 Reaxys:2090421 MetaCyc:CPD-12711 PMID:23302220 PMID:10648473 |
|
| definition |
A monohydroxybenzoic acid that is salicylic acid substituted by an amino group at the 5-position. |
|
| formula |
C7H7NO3 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
5-amino-2-hydroxybenzoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-carboxy-4-hydroxyaniline Mesasal Salofalk Fisalamine 5-Aminosalicylic acid Claversal mesalazina Pentasa Asacol Canasa mesalazinum mesalazine Asacolitin Mesalazine Rowasa m-Aminosalicylic acid p-Aminosalicylsaeure Iialda Lixacol 5-ASA |
|
| id |
CHEBI:6775 |
|
| in_subset | ||
| inchi |
InChI=1S/C7H7NO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9H,8H2,(H,10,11) |
|
| inchikey |
KBOPZPXVLCULAV-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
mesalamine |
|
| mass |
153.13540 |
|
| monoisotopicmass |
153.04259 |
|
| notation |
CHEBI:6775 |
|
| prefLabel |
mesalamine |
|
| smiles |
Nc1ccc(O)c(c1)C(O)=O |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_33860 http://purl.obolibrary.org/obo/CHEBI_33853 http://purl.obolibrary.org/obo/CHEBI_33709 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33860 http://purl.obolibrary.org/obo/CHEBI_33853 http://purl.obolibrary.org/obo/CHEBI_33709 |