loading...| Preferred Name | mephenytoin | |
| Synonyms |
phenylethylmethylhydantoin mephenytoine mephenytoinum DL-Mephenytoin mephenytoin methylphenetoin mefenitoina 5-ethyl-3-methyl-5-phenylimidazolidine-2,4-dione |
|
| Definitions |
An imidazolidine-2,4-dione (hydantoin) in which the imidazolidine nucleus carries a methyl group at N-3 and has ethyl and phenyl substituents at C-5. An anticonvulsant, it is no longer available in the USA or the UK but is still studied largely because of its interesting hydroxylation polymorphism. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6757 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:25797720 Drug_Central:1695 PMID:15282764 KEGG:D00375 Reaxys:17282 PMID:11422005 CAS:50-12-4 Wikipedia:Mephenytoin LINCS:LSM-1852 PMID:29438107 |
|
| definition |
An imidazolidine-2,4-dione (hydantoin) in which the imidazolidine nucleus carries a methyl group at N-3 and has ethyl and phenyl substituents at C-5. An anticonvulsant, it is no longer available in the USA or the UK but is still studied largely because of its interesting hydroxylation polymorphism. |
|
| formula |
C12H14N2O2 |
|
| has role | ||
| has_alternative_id |
CHEBI:91914 |
|
| has_exact_synonym |
5-ethyl-3-methyl-5-phenylimidazolidine-2,4-dione |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
phenylethylmethylhydantoin mephenytoine mephenytoinum DL-Mephenytoin mephenytoin methylphenetoin mefenitoina |
|
| id |
CHEBI:6757 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H14N2O2/c1-3-12(9-7-5-4-6-8-9)10(15)14(2)11(16)13-12/h4-8H,3H2,1-2H3,(H,13,16) |
|
| inchikey |
GMHKMTDVRCWUDX-UHFFFAOYSA-N |
|
| label |
mephenytoin |
|
| mass |
218.252 |
|
| monoisotopicmass |
218.10553 |
|
| notation |
CHEBI:6757 |
|
| prefLabel |
mephenytoin |
|
| smiles |
CCC1(C(=O)N(C(=O)N1)C)C2=CC=CC=C2 |
|
| treeView | ||
| subClassOf |