loading...| Preferred Name | meloxicam | |
| Synonyms |
UNII-VG2QF83CGL meloxicam meloxicamum Mobic 4-hydroxy-2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxide |
|
| Definitions |
A benzothiazine that is piroxicam in which the pyridin-2-yl group is replaced by a 5-methyl-1,3-thiazol-2-yl group. A non-steroidal anti-inflammatory drug and selective inhibitor of COX-2, it is used particularly for the management of rheumatoid arthritis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6741 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:24041211 PMID:19821429 PMID:28166217 PMID:16197363 PMID:23306395 PMID:10092958 HMDB:HMDB0014952 CAS:71125-38-7 PMID:24084190 KEGG:D00969 Drug_Central:1676 DrugBank:DB00814 Reaxys:5886369 Patent:DE2756113 PMID:12387696 Patent:US4233299 PMID:23388116 PMID:16863437 PMID:18405470 VSDB:1751 KEGG:C08169 PMID:23406022 PMID:9219316 PMID:8882380 PMID:16623613 |
|
| definition |
A benzothiazine that is piroxicam in which the pyridin-2-yl group is replaced by a 5-methyl-1,3-thiazol-2-yl group. A non-steroidal anti-inflammatory drug and selective inhibitor of COX-2, it is used particularly for the management of rheumatoid arthritis. |
|
| formula |
C14H13N3O4S2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_50629 http://purl.obolibrary.org/obo/CHEBI_35480 |
|
| has_exact_synonym |
4-hydroxy-2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
UNII-VG2QF83CGL meloxicam meloxicamum Mobic |
|
| id |
CHEBI:6741 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H13N3O4S2/c1-8-7-15-14(22-8)16-13(19)11-12(18)9-5-3-4-6-10(9)23(20,21)17(11)2/h3-7,18H,1-2H3,(H,15,16,19) |
|
| inchikey |
ZRVUJXDFFKFLMG-UHFFFAOYSA-N |
|
| label |
meloxicam |
|
| mass |
351.40100 |
|
| monoisotopicmass |
351.03475 |
|
| notation |
CHEBI:6741 |
|
| prefLabel |
meloxicam |
|
| smiles |
CN1C(C(=O)Nc2ncc(C)s2)=C(O)c2ccccc2S1(=O)=O |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_46899 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_46899 |