Preferred Name | levobunolol | |
Synonyms |
(-)-Bunolol levobunololum (S)-5-(3-((1,1-dimethylethyl)amino)-2-hydroxypropoxy)-3,4-dihydro-1(2H)-naphthalenone 5-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydronaphthalen-1(2H)-one Levobunolol |
|
Definitions |
A cyclic ketone that is 3,4-dihydronaphthalen-1-one substituted at position 5 by a 3-(tert-butylamino)-2-hydroxypropoxy group (the S-enantiomer). A non-selective beta-adrenergic antagonist used (as its hydrochloride salt) for treatment of glaucoma. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6438 |
|
charge |
0 |
|
database_cross_reference |
PMID:3067745 PMID:3062528 PMID:2873545 CAS:47141-42-4 PMID:19626454 LINCS:LSM-6578 Wikipedia:Levobunolol HMDB:HMDB0015341 Patent:WO2011140194 KEGG:D08115 PMID:21368570 PMID:30000211 Patent:US2011275617 PMID:17459374 PMID:37861808 PMID:3019819 DrugBank:DB01210 PMID:3050679 PMID:26227808 Drug_Central:431 Patent:WO2008002929 PMID:29277497 PMID:27190057 Reaxys:6484587 PMID:3513594 KEGG:C07914 PMID:3881032 PMID:20960417 PMID:3912600 PMID:2881799 Patent:US2011263638 PMID:34863129 PMID:3058836 PMID:23390358 |
|
definition |
A cyclic ketone that is 3,4-dihydronaphthalen-1-one substituted at position 5 by a 3-(tert-butylamino)-2-hydroxypropoxy group (the S-enantiomer). A non-selective beta-adrenergic antagonist used (as its hydrochloride salt) for treatment of glaucoma. |
|
formula |
C17H25NO3 |
|
has parent hydride | ||
has role | ||
has_exact_synonym |
5-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydronaphthalen-1(2H)-one Levobunolol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(-)-Bunolol levobunololum (S)-5-(3-((1,1-dimethylethyl)amino)-2-hydroxypropoxy)-3,4-dihydro-1(2H)-naphthalenone |
|
id |
CHEBI:6438 |
|
in_subset | ||
inchi |
InChI=1S/C17H25NO3/c1-17(2,3)18-10-12(19)11-21-16-9-5-6-13-14(16)7-4-8-15(13)20/h5-6,9,12,18-19H,4,7-8,10-11H2,1-3H3/t12-/m0/s1 |
|
inchikey |
IXHBTMCLRNMKHZ-LBPRGKRZSA-N |
|
is conjugate base of | ||
label |
levobunolol |
|
mass |
291.38534 |
|
monoisotopicmass |
291.18344 |
|
notation |
CHEBI:6438 |
|
prefLabel |
levobunolol |
|
smiles |
CC(C)(C)NC[C@H](O)COc1cccc2C(=O)CCCc12 |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_35533 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35533 |