loading...| Preferred Name |
diethylpropion hydrochloride |
|
| Synonyms |
DIETHYLPROPION HYDROCHLORIDE N,N-diethyl-1-oxo-1-phenylpropan-2-aminium chloride Diethylpropion hydrochloride 2-(diethylamino)-1-phenylpropan-1-one hydrochloride amphepramonum hydrochloride alpha-benzoyltriethylamine hydrochloride diethylpropion HCl amfepramone hydrochloride tenuate amfepramone HCl 2-(diethylamino)propiophenone hydrochloride alpha-benzoyltriethylammonium chloride |
|
| Definitions |
The hydrochloride salt of diethylpropion. A central stimulant and indirect-acting sympathomimetic, it is an appetite depressant and is used as an anoretic in the short term management of obesity. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_643703 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:134-80-5 DrugBank:DB00937 KEGG:D03801 Beilstein:3915870 |
|
| definition |
The hydrochloride salt of diethylpropion. A central stimulant and indirect-acting sympathomimetic, it is an appetite depressant and is used as an anoretic in the short term management of obesity. |
|
| formula |
C13H20ClNO |
|
| has part | ||
| has role | ||
| has_alternative_id |
CHEBI:130909 |
|
| has_exact_synonym |
DIETHYLPROPION HYDROCHLORIDE N,N-diethyl-1-oxo-1-phenylpropan-2-aminium chloride Diethylpropion hydrochloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-(diethylamino)-1-phenylpropan-1-one hydrochloride amphepramonum hydrochloride alpha-benzoyltriethylamine hydrochloride diethylpropion HCl amfepramone hydrochloride tenuate amfepramone HCl 2-(diethylamino)propiophenone hydrochloride alpha-benzoyltriethylammonium chloride |
|
| id |
CHEBI:643703 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H19NO.ClH/c1-4-14(5-2)11(3)13(15)12-9-7-6-8-10-12;/h6-11H,4-5H2,1-3H3;1H |
|
| inchikey |
ICFXZZFWRWNZMA-UHFFFAOYSA-N |
|
| label |
diethylpropion hydrochloride |
|
| mass |
241.75700 |
|
| monoisotopicmass |
241.12334 |
|
| notation |
CHEBI:643703 |
|
| prefLabel |
diethylpropion hydrochloride |
|
| smiles |
[Cl-].CC[NH+](CC)C(C)C(=O)c1ccccc1 |
|
| treeView | ||
| subClassOf |