loading...| Preferred Name |
tenofovir disoproxil fumarate |
|
| Synonyms |
bis({[(propan-2-yloxy)carbonyl]oxy}methyl) ({[(2R)-1-(6-amino-9H-purin-9-yl)propan-2-yl]oxy}methyl)phosphonate (2E)-but-2-enedioate Viread 9-((R)-2-((bis(((isopropoxycarbonyl)oxy)methoxy)phosphinyl)methoxy)propyl)adenine fumarate tenofovir DF TDF |
|
| Definitions |
A fumarate salt prepared from equimolar amounts of tenofovir disoproxil and fumaric acid. It is used in combination therapy for the treatment of HIV infection. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_63718 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB00300 PMID:23466649 PMID:22928893 PMID:19372836 CAS:202138-50-9 PMID:15482138 PMID:18434949 PMID:15669881 Wikipedia:Tenofovir PMID:12064015 PMID:22210639 Reaxys:9831556 PMID:22077579 KEGG:D01982 |
|
| definition |
A fumarate salt prepared from equimolar amounts of tenofovir disoproxil and fumaric acid. It is used in combination therapy for the treatment of HIV infection. |
|
| formula |
C23H34N5O14P |
|
| has part | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_53756 |
|
| has_exact_synonym |
bis({[(propan-2-yloxy)carbonyl]oxy}methyl) ({[(2R)-1-(6-amino-9H-purin-9-yl)propan-2-yl]oxy}methyl)phosphonate (2E)-but-2-enedioate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Viread 9-((R)-2-((bis(((isopropoxycarbonyl)oxy)methoxy)phosphinyl)methoxy)propyl)adenine fumarate tenofovir DF TDF |
|
| id |
CHEBI:63718 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H30N5O10P.C4H4O4/c1-12(2)33-18(25)28-9-31-35(27,32-10-29-19(26)34-13(3)4)11-30-14(5)6-24-8-23-15-16(20)21-7-22-17(15)24;5-3(6)1-2-4(7)8/h7-8,12-14H,6,9-11H2,1-5H3,(H2,20,21,22);1-2H,(H,5,6)(H,7,8)/b;2-1+/t14-;/m1./s1 |
|
| inchikey |
VCMJCVGFSROFHV-WZGZYPNHSA-N |
|
| label |
tenofovir disoproxil fumarate |
|
| mass |
635.51490 |
|
| monoisotopicmass |
635.18399 |
|
| notation |
CHEBI:63718 |
|
| prefLabel |
tenofovir disoproxil fumarate |
|
| smiles |
OC(=O)\C=C\C(O)=O.CC(C)OC(=O)OCOP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc12)OCOC(=O)OC(C)C |
|
| treeView | ||
| subClassOf |