Preferred Name | topotecan | |
Synonyms |
topotecane topotecan topotecanum 9-[(dimethylamino)methyl]-10-hydroxy-(4S)-camptothecin Topotecan (4S)-10-[(dimethylamino)methyl]-4-ethyl-4,9-dihydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione |
|
Definitions |
A pyranoindolizinoquinoline used as an antineoplastic agent. It is a derivative of camptothecin and works by binding to the topoisomerase I-DNA complex and preventing religation of these 328 single strand breaks. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_63632 |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-5662 KEGG:D08618 PMID:22136714 Patent:EP321122 PMID:22190039 Wikipedia:Topotecan KEGG:C11158 PMID:21255983 PMID:21352915 DrugBank:DB01030 Reaxys:4279441 PDBeChem:TTC PMID:22028494 PMID:22075006 PMID:20574789 CAS:123948-87-8 PMID:21910214 |
|
definition |
A pyranoindolizinoquinoline used as an antineoplastic agent. It is a derivative of camptothecin and works by binding to the topoisomerase I-DNA complex and preventing religation of these 328 single strand breaks. |
|
formula |
C23H23N3O5 |
|
has role | ||
has_alternative_id |
CHEBI:9634 |
|
has_exact_synonym |
Topotecan (4S)-10-[(dimethylamino)methyl]-4-ethyl-4,9-dihydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
topotecane topotecan topotecanum 9-[(dimethylamino)methyl]-10-hydroxy-(4S)-camptothecin |
|
id |
CHEBI:63632 |
|
in_subset | ||
inchi |
InChI=1S/C23H23N3O5/c1-4-23(30)16-8-18-20-12(9-26(18)21(28)15(16)11-31-22(23)29)7-13-14(10-25(2)3)19(27)6-5-17(13)24-20/h5-8,27,30H,4,9-11H2,1-3H3/t23-/m0/s1 |
|
inchikey |
UCFGDBYHRUNTLO-QHCPKHFHSA-N |
|
label |
topotecan |
|
mass |
421.44580 |
|
monoisotopicmass |
421.16377 |
|
notation |
CHEBI:63632 |
|
prefLabel |
topotecan |
|
smiles |
CC[C@@]1(O)C(=O)OCc2c1cc1-c3nc4ccc(O)c(CN(C)C)c4cc3Cn1c2=O |
|
treeView | ||
subClassOf |