loading...| Preferred Name | propafenone | |
| Synonyms |
propafenona propafenone 1-(2-(2-hydroxy-3-(propylamino)propoxy)phenyl)-3-phenyl-1-propanone propafenonum 2-(2'-hydroxy-3'-propylaminopropoxy)-omega-phenylpropiophenone 1-{2-[2-hydroxy-3-(propylamino)propoxy]phenyl}-3-phenylpropan-1-one |
|
| Definitions |
An aromatic ketone that is 3-(propylamino)propane-1,2-diol in which the hydrogen of the primary hydroxy group is replaced by a 2-(3-phenylpropanoyl)phenyl group. It is a class 1C antiarrhythmic drug with local anesthetic effects, and is used as the hydrochloride salt in the management of supraventricular and ventricular arrhythmias. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_63619 |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:2291 Patent:DE2001431 Reaxys:2175182 Wikipedia:Propafenone CAS:54063-53-5 KEGG:C07381 DrugBank:DB01182 PMID:8777484 KEGG:D08435 LINCS:LSM-1416 |
|
| definition |
An aromatic ketone that is 3-(propylamino)propane-1,2-diol in which the hydrogen of the primary hydroxy group is replaced by a 2-(3-phenylpropanoyl)phenyl group. It is a class 1C antiarrhythmic drug with local anesthetic effects, and is used as the hydrochloride salt in the management of supraventricular and ventricular arrhythmias. |
|
| formula |
C21H27NO3 |
|
| has role | ||
| has_alternative_id |
CHEBI:8465 |
|
| has_exact_synonym |
1-{2-[2-hydroxy-3-(propylamino)propoxy]phenyl}-3-phenylpropan-1-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
propafenona propafenone 1-(2-(2-hydroxy-3-(propylamino)propoxy)phenyl)-3-phenyl-1-propanone propafenonum 2-(2'-hydroxy-3'-propylaminopropoxy)-omega-phenylpropiophenone |
|
| id |
CHEBI:63619 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H27NO3/c1-2-14-22-15-18(23)16-25-21-11-7-6-10-19(21)20(24)13-12-17-8-4-3-5-9-17/h3-11,18,22-23H,2,12-16H2,1H3 |
|
| inchikey |
JWHAUXFOSRPERK-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
propafenone |
|
| mass |
341.44400 |
|
| monoisotopicmass |
341.19909 |
|
| notation |
CHEBI:63619 |
|
| prefLabel |
propafenone |
|
| smiles |
CCCNCC(O)COc1ccccc1C(=O)CCc1ccccc1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_50995 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50995 |