Preferred Name |
erythrityl tetranitrate |
|
Synonyms |
erythrol tetranitrate tetranitrate d'eritrityle 1,2,3,4-butanetetralyl tetranitrate tetranitrato de eritritilo (2R*,3S)-rel-1,2,3,4-butanetetroltetranitrate eritrityl tetranitrate tetranitrol erythritol tetranitrate meso-erythritol tetranitrate ETN tetranitrin eritrityli tetranitras (2R*,3S*)-3,4-bis(nitrooxy)butane-1,2-diyl dinitrate |
|
Definitions |
Erythritol in which each of the hydroxy groups has been converted to the corresponding nitrate ester. It is a vasodilator with properties similar to nitroglycerin. It is usually used diluted with lactose or other suitable inert excipients, in order to minimise the risk of explosion; undiluted erythrityl tetranitrate can be exploded by percussion or excessive heat. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_60072 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB01613 Beilstein:1730082 KEGG:D04051 Wikipedia:Erythritol_tetranitrate Drug_Central:1047 CAS:7297-25-8 |
|
definition |
Erythritol in which each of the hydroxy groups has been converted to the corresponding nitrate ester. It is a vasodilator with properties similar to nitroglycerin. It is usually used diluted with lactose or other suitable inert excipients, in order to minimise the risk of explosion; undiluted erythrityl tetranitrate can be exploded by percussion or excessive heat. |
|
formula |
C4H6N4O12 |
|
has functional parent | ||
has role | ||
has_exact_synonym |
(2R*,3S*)-3,4-bis(nitrooxy)butane-1,2-diyl dinitrate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
erythrol tetranitrate tetranitrate d'eritrityle 1,2,3,4-butanetetralyl tetranitrate tetranitrato de eritritilo (2R*,3S)-rel-1,2,3,4-butanetetroltetranitrate eritrityl tetranitrate tetranitrol erythritol tetranitrate meso-erythritol tetranitrate ETN tetranitrin eritrityli tetranitras |
|
id |
CHEBI:60072 |
|
in_subset | ||
inchi |
InChI=1S/C4H6N4O12/c9-5(10)17-1-3(19-7(13)14)4(20-8(15)16)2-18-6(11)12/h3-4H,1-2H2/t3-,4+ |
|
inchikey |
SNFOERUNNSHUGP-ZXZARUISSA-N |
|
label |
erythrityl tetranitrate |
|
mass |
302.11000 |
|
monoisotopicmass |
301.99822 |
|
notation |
CHEBI:60072 |
|
prefLabel |
erythrityl tetranitrate |
|
smiles |
[O-][N+](=O)OC[C@@H](O[N+]([O-])=O)[C@H](CO[N+]([O-])=O)O[N+]([O-])=O |
|
treeView | ||
subClassOf |