Preferred Name |
quaternium-15 |
|
Synonyms |
1-[3-chloroprop-2-en-1-yl]-3,5,7-triaza-1-azoniatricyclo[3.3.1.1(3),(7)]decanium chloride 1-(3-chloro-2-propenyl)-3,5,7-triaza-1-azoniatricyclo(3.3.1.13,7)decane chloride quaternium 15 1-(3-Chloroallyl)-3,5,7-triaza-1-azoniaadamantane chloride CTAC Hexamethylenetetramine chloroallyl chloride N-(3-Chloroallyl)hexaminium chloride Methenamine 3-chloroallylochloride |
|
Definitions |
A quaternary ammonium salt derived from hexamethylenetetramine; used as a preservative in many cosmetics and industrial substances. Also acts as a disinfectant and allergenic agent. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_59607 |
|
charge |
0 |
|
database_cross_reference |
PMID:20448270 PMID:26821003 PMID:21616561 PMID:15462465 PMID:22653068 Beilstein:9300843 PMID:20433443 CAS:4080-31-3 |
|
definition |
A quaternary ammonium salt derived from hexamethylenetetramine; used as a preservative in many cosmetics and industrial substances. Also acts as a disinfectant and allergenic agent. |
|
formula |
C9H16Cl2N4 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_33282 http://purl.obolibrary.org/obo/CHEBI_59174 |
|
has_exact_synonym |
1-[3-chloroprop-2-en-1-yl]-3,5,7-triaza-1-azoniatricyclo[3.3.1.1(3),(7)]decanium chloride |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1-(3-chloro-2-propenyl)-3,5,7-triaza-1-azoniatricyclo(3.3.1.13,7)decane chloride quaternium 15 1-(3-Chloroallyl)-3,5,7-triaza-1-azoniaadamantane chloride CTAC Hexamethylenetetramine chloroallyl chloride N-(3-Chloroallyl)hexaminium chloride Methenamine 3-chloroallylochloride |
|
id |
CHEBI:59607 |
|
in_subset | ||
inchi |
InChI=1S/C9H16ClN4.ClH/c10-2-1-3-14-7-11-4-12(8-14)6-13(5-11)9-14;/h1-2H,3-9H2;1H/q+1;/p-1 |
|
inchikey |
UKHVLWKBNNSRRR-UHFFFAOYSA-M |
|
label |
quaternium-15 |
|
mass |
251.15600 |
|
monoisotopicmass |
250.07520 |
|
notation |
CHEBI:59607 |
|
prefLabel |
quaternium-15 |
|
smiles |
[Cl-].[H]C(Cl)=C([H])C[N+]12CN3CN(CN(C3)C1)C2 |
|
treeView | ||
subClassOf |