loading...| Preferred Name | biperiden hydrochloride | |
| Synonyms |
biperiden HCl 1-[3-(bicyclo[2.2.1]hept-5-en-2-yl)-3-hydroxy-3-phenylpropyl]piperidinium chloride 1-[3-(bicyclo[2.2.1]hept-5-en-2-yl)-3-hydroxy-3-phenylpropyl]piperidine hydrochloride 1-bicycloheptenyl-1-phenyl-3-piperidinopropanol-1 hydrochloride 1-(bicyclo[2.2.1]hept-5-en-2-yl)-1-phenyl-3-(piperidin-1-yl)propan-1-ol hydrochloride |
|
| Definitions |
The hydrochloride salt of biperiden. A muscarinic antagonist affecting both the central and peripheral nervous systems, it is used in the treatment of all forms of Parkinson's disease. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_59171 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:1235-82-1 Beilstein:8366991 DrugBank:DB00810 |
|
| definition |
The hydrochloride salt of biperiden. A muscarinic antagonist affecting both the central and peripheral nervous systems, it is used in the treatment of all forms of Parkinson's disease. |
|
| formula |
C21H30ClNO |
|
| has part | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_48876 |
|
| has_exact_synonym |
1-(bicyclo[2.2.1]hept-5-en-2-yl)-1-phenyl-3-(piperidin-1-yl)propan-1-ol hydrochloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
biperiden HCl 1-[3-(bicyclo[2.2.1]hept-5-en-2-yl)-3-hydroxy-3-phenylpropyl]piperidinium chloride 1-[3-(bicyclo[2.2.1]hept-5-en-2-yl)-3-hydroxy-3-phenylpropyl]piperidine hydrochloride 1-bicycloheptenyl-1-phenyl-3-piperidinopropanol-1 hydrochloride |
|
| id |
CHEBI:59171 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H29NO.ClH/c23-21(19-7-3-1-4-8-19,11-14-22-12-5-2-6-13-22)20-16-17-9-10-18(20)15-17;/h1,3-4,7-10,17-18,20,23H,2,5-6,11-16H2;1H |
|
| inchikey |
RDNLAULGBSQZMP-UHFFFAOYSA-N |
|
| label |
biperiden hydrochloride |
|
| mass |
347.92200 |
|
| monoisotopicmass |
347.20159 |
|
| notation |
CHEBI:59171 |
|
| prefLabel |
biperiden hydrochloride |
|
| smiles |
[Cl-].OC(CC[NH+]1CCCCC1)(C1CC2CC1C=C2)c1ccccc1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_36807 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36807 |