loading...| Preferred Name | indapamide | |
| Synonyms |
indapamidum indapamida Indapamide 4-chloro-N-(2-methyl-2,3-dihydro-1H-indol-1-yl)-3-sulfamoylbenzamide |
|
| Definitions |
A sulfonamide formed by condensation of the carboxylic group of 4-chloro-3-sulfamoylbenzoic acid with the amino group of 2-methyl-2,3-dihydro-1H-indol-1-amine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5893 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:26807-65-8 PMID:22606892 Reaxys:1604026 Wikipedia:Indapamide Patent:US3565911 Drug_Central:1433 PMID:22579001 DrugBank:DB00808 PMID:22725706 KEGG:D00345 Patent:FR2003311 PMID:22567944 LINCS:LSM-1936 |
|
| definition |
A sulfonamide formed by condensation of the carboxylic group of 4-chloro-3-sulfamoylbenzoic acid with the amino group of 2-methyl-2,3-dihydro-1H-indol-1-amine. |
|
| formula |
C16H16ClN3O3S |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
Indapamide 4-chloro-N-(2-methyl-2,3-dihydro-1H-indol-1-yl)-3-sulfamoylbenzamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
indapamidum indapamida |
|
| id |
CHEBI:5893 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H16ClN3O3S/c1-10-8-11-4-2-3-5-14(11)20(10)19-16(21)12-6-7-13(17)15(9-12)24(18,22)23/h2-7,9-10H,8H2,1H3,(H,19,21)(H2,18,22,23) |
|
| inchikey |
NDDAHWYSQHTHNT-UHFFFAOYSA-N |
|
| label |
indapamide |
|
| mass |
365.83500 |
|
| monoisotopicmass |
365.06009 |
|
| notation |
CHEBI:5893 |
|
| prefLabel |
indapamide |
|
| smiles |
CC1Cc2ccccc2N1NC(=O)c1ccc(Cl)c(c1)S(N)(=O)=O |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_35358 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35358 |