loading...| Preferred Name |
glyceraldehyde |
|
| Synonyms |
glyceraldehyde 2,3-dihydroxypropanal Glyceraldehyde Glycerose glyceric aldehyde glycerinaldehyde 2,3-Dihydroxypropanal Glycerinaldehyd glycerose Glyceraldehyd 2,3-Dihydroxypropionaldehyde Aldotriose glycerinformal Glyzerinaldehyd gliceraldehido DL-glyceraldehyde alpha,beta-dihydroxypropionaldehyde (+-)-glyceraldehyde |
|
| Definitions |
An aldotriose comprising propanal having hydroxy groups at the 2- and 3-positions. It plays role in the formation of advanced glycation end-products (AGEs), a deleterious accompaniment to ageing. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5445 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:20371493 PMID:9506998 CAS:56-82-6 PMID:18791692 PMID:18256486 Beilstein:635844 HMDB:HMDB0001051 MetaCyc:CPD0-1551 KEGG:C02154 CAS:367-47-5 PMID:18087047 DrugBank:DB02536 Gmelin:164389 KNApSAcK:C00007413 PMID:21707087 Reaxys:635844 Wikipedia:Glyceraldehyde PMID:23543734 |
|
| definition |
An aldotriose comprising propanal having hydroxy groups at the 2- and 3-positions. It plays role in the formation of advanced glycation end-products (AGEs), a deleterious accompaniment to ageing. |
|
| formula |
C3H6O3 |
|
| has role | ||
| has_alternative_id |
CHEBI:387614 CHEBI:24343 |
|
| has_exact_synonym |
glyceraldehyde 2,3-dihydroxypropanal Glyceraldehyde |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Glycerose glyceric aldehyde glycerinaldehyde 2,3-Dihydroxypropanal Glycerinaldehyd glycerose Glyceraldehyd 2,3-Dihydroxypropionaldehyde Aldotriose glycerinformal Glyzerinaldehyd gliceraldehido DL-glyceraldehyde alpha,beta-dihydroxypropionaldehyde (+-)-glyceraldehyde |
|
| id |
CHEBI:5445 |
|
| in_subset | ||
| inchi |
InChI=1S/C3H6O3/c4-1-3(6)2-5/h1,3,5-6H,2H2 |
|
| inchikey |
MNQZXJOMYWMBOU-UHFFFAOYSA-N |
|
| label |
glyceraldehyde |
|
| mass |
90.07794 |
|
| monoisotopicmass |
90.03169 |
|
| notation |
CHEBI:5445 |
|
| prefLabel |
glyceraldehyde |
|
| smiles |
[H]C(=O)C(O)CO |
|
| treeView | ||
| subClassOf |