Preferred Name |
epiandrosterone |
|
Synonyms |
3beta-hydroxy-5alpha-androstan-17-one 3-Epiandrosterone 3beta-Hydroxyetioallocholan-17-one d-Epiandrosterone iso-Androsterone Isoandrosterone |
|
Definitions |
A 3beta-hydroxy steroid that is (5alpha)-androstane substituted by a beta-hydroxy group at position 3 and an oxo group at position 17. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_541975 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:1884007 CAS:481-29-8 PMID:12054855 MetaCyc:CPD-13750 PMID:18307294 KEGG:C07635 LIPID_MAPS_instance:LMST02020023 Wikipedia:Epiandrosterone HMDB:HMDB0000365 |
|
definition |
A 3beta-hydroxy steroid that is (5alpha)-androstane substituted by a beta-hydroxy group at position 3 and an oxo group at position 17. |
|
formula |
C19H30O2 |
|
has functional parent | ||
has role | ||
has_alternative_id |
CHEBI:4802 |
|
has_exact_synonym |
3beta-hydroxy-5alpha-androstan-17-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
3-Epiandrosterone 3beta-Hydroxyetioallocholan-17-one d-Epiandrosterone iso-Androsterone 3beta-hydroxy-5alpha-androstan-17-one Isoandrosterone |
|
id |
CHEBI:541975 |
|
in_subset | ||
inchi |
InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12-16,20H,3-11H2,1-2H3/t12-,13-,14-,15-,16-,18-,19-/m0/s1 |
|
inchikey |
QGXBDMJGAMFCBF-LUJOEAJASA-N |
|
label |
epiandrosterone |
|
mass |
290.44030 |
|
monoisotopicmass |
290.22458 |
|
notation |
CHEBI:541975 |
|
prefLabel |
epiandrosterone |
|
smiles |
[H][C@@]12CC[C@@]3([H])[C@]4([H])CCC(=O)[C@@]4(C)CC[C@]3([H])[C@@]1(C)CC[C@H](O)C2 |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_50402 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50402 |