loading...| Preferred Name |
alverine citrate |
|
| Synonyms |
N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine 2-hydroxypropane-1,2,3-tricarboxylate N-Ethyl-3,3'-diphenyldipropylamine citrate |
|
| Definitions |
The citrate salt of alverine, resulting from the reaction of equimolar amounts of alvarine and citric acid. An antispasmodic that acts directly on intestinal and uterine smooth muscle, it is used in the treatment of irritable bowel syndrome. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_53785 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:19115153 PMID:20415841 PMID:19148544 PMID:15259090 DrugBank:DB01616 Patent:CN101838205 CAS:5560-59-8 Reaxys:3851428 PMID:21698811 Beilstein:3851428 PMID:17934514 PMID:20375645 PMID:12030962 KEGG:D02877 PMID:20003095 |
|
| definition |
The citrate salt of alverine, resulting from the reaction of equimolar amounts of alvarine and citric acid. An antispasmodic that acts directly on intestinal and uterine smooth muscle, it is used in the treatment of irritable bowel syndrome. |
|
| formula |
C20H27N.C6H8O7 C26H35NO7 |
|
| has part | ||
| has role | ||
| has_exact_synonym |
N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine 2-hydroxypropane-1,2,3-tricarboxylate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
N-Ethyl-3,3'-diphenyldipropylamine citrate |
|
| id |
CHEBI:53785 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H27N.C6H8O7/c1-2-21(17-9-15-19-11-5-3-6-12-19)18-10-16-20-13-7-4-8-14-20;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-8,11-14H,2,9-10,15-18H2,1H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
|
| inchikey |
RYHCACJBKCOBTJ-UHFFFAOYSA-N |
|
| label |
alverine citrate |
|
| mass |
473.55860 |
|
| monoisotopicmass |
473.24135 |
|
| notation |
CHEBI:53785 |
|
| prefLabel |
alverine citrate |
|
| smiles |
OC(=O)CC(O)(CC(O)=O)C(O)=O.CCN(CCCc1ccccc1)CCCc1ccccc1 |
|
| treeView | ||
| subClassOf |