loading...| Preferred Name |
alverine |
|
| Synonyms |
N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine alverine N,N-Bis(3-phenylpropyl)ethylamine Di(phenylpropyl)ethylamine N-Ethyl-N-(3-phenylpropyl)benzenepropanamine alverina N-Ethyl-3,3'-diphenyldipropylamine Phenpropamine Bis(gamma-phenylpropyl)ethylamine N-Ethyl-3-phenyl-N-(3-phenylpropyl)-1-propanamine Phenopropamine alverinum |
|
| Definitions |
A tertiary amine having one ethyl and two 3-phenylprop-1-yl groups attached to the nitrogen. An antispasmodic that acts directly on intestinal and uterine smooth muscle, it is used (particularly as the citrate salt) in the treatment of irritable bowel syndrome. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_518413 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:150-59-4 Drug_Central:142 DrugBank:DB01616 LINCS:LSM-3988 KEGG:D07440 Beilstein:2856783 |
|
| definition |
A tertiary amine having one ethyl and two 3-phenylprop-1-yl groups attached to the nitrogen. An antispasmodic that acts directly on intestinal and uterine smooth muscle, it is used (particularly as the citrate salt) in the treatment of irritable bowel syndrome. |
|
| formula |
C20H27N |
|
| has role | ||
| has_exact_synonym |
N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
alverine N,N-Bis(3-phenylpropyl)ethylamine Di(phenylpropyl)ethylamine N-Ethyl-N-(3-phenylpropyl)benzenepropanamine alverina N-Ethyl-3,3'-diphenyldipropylamine Phenpropamine Bis(gamma-phenylpropyl)ethylamine N-Ethyl-3-phenyl-N-(3-phenylpropyl)-1-propanamine Phenopropamine alverinum |
|
| id |
CHEBI:518413 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H27N/c1-2-21(17-9-15-19-11-5-3-6-12-19)18-10-16-20-13-7-4-8-14-20/h3-8,11-14H,2,9-10,15-18H2,1H3 |
|
| inchikey |
ZPFXAOWNKLFJDN-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
alverine |
|
| mass |
281.43510 |
|
| monoisotopicmass |
281.21435 |
|
| notation |
CHEBI:518413 |
|
| prefLabel |
alverine |
|
| smiles |
CCN(CCCc1ccccc1)CCCc1ccccc1 |
|
| treeView | ||
| subClassOf |