Preferred Name |
amoxicillin sodium |
|
Synonyms |
sodium 6beta-[(2R)-2-amino-2-(4-hydroxyphenyl)acetamido]-2,2-dimethylpenam-3alpha-carboxylate amoxicillin natrium Ibiamox Acuotricina sodium amoxicillin |
|
Definitions |
An organic sodium salt that is the monosodium salt of amoxicillin. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_51255 |
|
charge |
0 |
|
database_cross_reference |
PMID:27731424 Beilstein:6050145 CAS:34642-77-8 Reaxys:6050145 |
|
definition |
An organic sodium salt that is the monosodium salt of amoxicillin. |
|
formula |
C16H18N3NaO5S |
|
has part | ||
has_exact_synonym |
sodium 6beta-[(2R)-2-amino-2-(4-hydroxyphenyl)acetamido]-2,2-dimethylpenam-3alpha-carboxylate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
amoxicillin natrium Ibiamox Acuotricina sodium amoxicillin |
|
id |
CHEBI:51255 |
|
in_subset | ||
inchi |
InChI=1S/C16H19N3O5S.Na/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7;/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24);/q;+1/p-1/t9-,10-,11+,14-;/m1./s1 |
|
inchikey |
BYHDFCISJXIVBV-YWUHCJSESA-M |
|
label |
amoxicillin sodium |
|
mass |
387.38711 |
|
monoisotopicmass |
387.08649 |
|
notation |
CHEBI:51255 |
|
prefLabel |
amoxicillin sodium |
|
smiles |
[Na+].[H][C@]12SC(C)(C)[C@@H](N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccc(O)cc1)C([O-])=O |
|
treeView | ||
subClassOf |