loading...| Preferred Name |
flecainide acetate |
|
| Synonyms |
2-({[2,5-bis(2,2,2-trifluoroethoxy)benzoyl]amino}methyl)piperidinium acetate N-(piperidin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide acetate flecainide monoacetate N-(Piperidin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide monoacetate Tambocor R 818 R-818 |
|
| Definitions |
An acetate salt obtained by combining flecainide with one molar equivalent of acetic acid. An antiarrhythmic agent used to prevent and treat tachyarrhythmia (abnormal fast rhythm of the heart). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5091 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:EP1918280 PMID:20154349 PMID:20435235 PMID:7199921 PMID:7137036 PMID:1529992 PMID:7776114 DrugBank:DB01195 KEGG:D00638 PMID:6682665 PMID:21249720 Patent:WO2011098194 PMID:94625 PMID:16502500 Wikipedia:Flecainide PMID:23294160 PMID:12049386 PMID:9475360 Patent:EP2359814 PMID:6823856 PMID:22190323 Reaxys:4119882 CAS:54143-56-5 PMID:11475838 |
|
| definition |
An acetate salt obtained by combining flecainide with one molar equivalent of acetic acid. An antiarrhythmic agent used to prevent and treat tachyarrhythmia (abnormal fast rhythm of the heart). |
|
| formula |
C17H20F6N2O3.C2H4O2 C19H24F6N2O5 |
|
| has part | ||
| has role | ||
| has_alternative_id |
CHEBI:76029 |
|
| has_exact_synonym |
2-({[2,5-bis(2,2,2-trifluoroethoxy)benzoyl]amino}methyl)piperidinium acetate N-(piperidin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide acetate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
flecainide monoacetate N-(Piperidin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide monoacetate Tambocor R 818 R-818 |
|
| id |
CHEBI:5091 |
|
| in_subset | ||
| inchi |
InChI=1S/C17H20F6N2O3.C2H4O2/c18-16(19,20)9-27-12-4-5-14(28-10-17(21,22)23)13(7-12)15(26)25-8-11-3-1-2-6-24-11;1-2(3)4/h4-5,7,11,24H,1-3,6,8-10H2,(H,25,26);1H3,(H,3,4) |
|
| inchikey |
RKXNZRPQSOPPRN-UHFFFAOYSA-N |
|
| label |
flecainide acetate |
|
| mass |
474.39470 |
|
| monoisotopicmass |
474.15894 |
|
| notation |
CHEBI:5091 |
|
| prefLabel |
flecainide acetate |
|
| smiles |
CC(O)=O.FC(F)(F)COc1ccc(OCC(F)(F)F)c(c1)C(=O)NCC1CCCCN1 |
|
| treeView | ||
| subClassOf |