Preferred Name |
flavanone |
|
Synonyms |
flavanone 2-phenyl-2,3-dihydro-4H-chromen-4-one Flavanone 2,3-Dihydroflavone 2-phenylchroman-4-one 2-phenyl-4-chromanone 2,3-dihydro-2-phenyl-4H-1-benzopyran-4-one |
|
Definitions |
The simplest member of the class of flavanones that consists of flavan bearing an oxo substituent at position 4. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5070 |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-1283 Reaxys:85290 KEGG:C00766 Beilstein:183227 MetaCyc:FLAVANONES CAS:487-26-3 Beilstein:85290 |
|
definition |
The simplest member of the class of flavanones that consists of flavan bearing an oxo substituent at position 4. |
|
formula |
C15H12O2 |
|
has parent hydride | ||
has_exact_synonym |
flavanone 2-phenyl-2,3-dihydro-4H-chromen-4-one Flavanone |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2,3-Dihydroflavone 2-phenylchroman-4-one 2-phenyl-4-chromanone 2,3-dihydro-2-phenyl-4H-1-benzopyran-4-one |
|
id |
CHEBI:5070 |
|
in_subset | ||
inchi |
InChI=1S/C15H12O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-9,15H,10H2 |
|
inchikey |
ZONYXWQDUYMKFB-UHFFFAOYSA-N |
|
label |
flavanone |
|
mass |
224.25458 |
|
monoisotopicmass |
224.08373 |
|
notation |
CHEBI:5070 |
|
prefLabel |
flavanone |
|
smiles |
O=C1CC(Oc2ccccc12)c1ccccc1 |
|
treeView | ||
subClassOf |