Preferred Name |
milrinone |
|
Synonyms |
milrinona milrinonum 1,6-Dihydro-2-methyl-6-oxo(3,4'-bipyridine)-5-carbonitrile milrinone Milrinone 2-methyl-6-oxo-1,6-dihydro-3,4'-bipyridine-5-carbonitrile |
|
Definitions |
A member of the class of bipyridines that is 2-pyridone which is substituted at positions 3, 5, and 6 by cyano, pyrid-4-yl, and methyl groups, respectively. It is used (particularly intravenously, as the lactate) for the short-term management of severe heart failure. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_50693 |
|
charge |
0 |
|
database_cross_reference |
PMID:21905056 DrugBank:DB00235 LINCS:LSM-3493 Drug_Central:1809 Reaxys:3546821 Patent:US4313951 PDBeChem:MIL Patent:US4413127 Patent:BE886336 PMID:21971319 PMID:14638547 Wikipedia:Milrinone KEGG:C07224 KEGG:D00417 PMID:10634314 Beilstein:3546821 CAS:78415-72-2 HMDB:HMDB0014380 PMID:14624413 |
|
definition |
A member of the class of bipyridines that is 2-pyridone which is substituted at positions 3, 5, and 6 by cyano, pyrid-4-yl, and methyl groups, respectively. It is used (particularly intravenously, as the lactate) for the short-term management of severe heart failure. |
|
formula |
C12H9N3O |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_50568 http://purl.obolibrary.org/obo/CHEBI_50427 |
|
has_alternative_id |
CHEBI:6938 CHEBI:44019 |
|
has_exact_synonym |
Milrinone 2-methyl-6-oxo-1,6-dihydro-3,4'-bipyridine-5-carbonitrile |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
milrinona milrinonum 1,6-Dihydro-2-methyl-6-oxo(3,4'-bipyridine)-5-carbonitrile milrinone |
|
id |
CHEBI:50693 |
|
in_subset | ||
inchi |
InChI=1S/C12H9N3O/c1-8-11(9-2-4-14-5-3-9)6-10(7-13)12(16)15-8/h2-6H,1H3,(H,15,16) |
|
inchikey |
PZRHRDRVRGEVNW-UHFFFAOYSA-N |
|
label |
milrinone |
|
mass |
211.21948 |
|
monoisotopicmass |
211.07456 |
|
notation |
CHEBI:50693 |
|
prefLabel |
milrinone |
|
smiles |
Cc1[nH]c(=O)c(cc1-c1ccncc1)C#N |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_38183 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38183 |