loading...| Preferred Name |
etidronate disodium |
|
| Synonyms |
disodium (1-hydroxyethane-1,1-diyl)bis[hydrogen (phosphonate)] sodium ethydronate disodium dihydrogen (1-hydroxyethylidene)diphosphonate disodium ethanol-1,1-diphosphonate disodium ethydronate disodium etidronate disodium (1-hydroxyethylidene)diphosphonate sodium ethidronate disodium ethane-1-hydroxy-1,1-diphosphonate sodium etidronate (1-hydroxyethane-1,1-diyl)diphosphonic acid disodium salt disodium 1-hydroxyethylidene phosphonate Didronel 1-hydroxyethylidene-1,1-diphosphonic acid disodium salt (1-hydroxyethylidene)diphosphonic acid, disodium salt |
|
| Definitions |
An organic sodium salt resulting from the replacement of two protons from etidronic acid (one from from each of the phosphonic acid groups) by sodium ions. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4906 |
|
| charge |
0 |
|
| database_cross_reference |
HMDB:HMDB0015210 KEGG:D00314 DrugBank:DB01077 Reaxys:5190835 PMID:3933343 PMID:6280538 CAS:7414-83-7 PMID:11484098 PMID:824086 PMID:106728 PMID:3100312 |
|
| definition |
An organic sodium salt resulting from the replacement of two protons from etidronic acid (one from from each of the phosphonic acid groups) by sodium ions. |
|
| formula |
C2H6Na2O7P2 |
|
| has part | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
| has_exact_synonym |
disodium (1-hydroxyethane-1,1-diyl)bis[hydrogen (phosphonate)] |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
sodium ethydronate disodium dihydrogen (1-hydroxyethylidene)diphosphonate disodium ethanol-1,1-diphosphonate disodium ethydronate disodium etidronate disodium (1-hydroxyethylidene)diphosphonate sodium ethidronate disodium ethane-1-hydroxy-1,1-diphosphonate sodium etidronate (1-hydroxyethane-1,1-diyl)diphosphonic acid disodium salt disodium 1-hydroxyethylidene phosphonate Didronel 1-hydroxyethylidene-1,1-diphosphonic acid disodium salt (1-hydroxyethylidene)diphosphonic acid, disodium salt |
|
| id |
CHEBI:4906 |
|
| in_subset | ||
| inchi |
InChI=1S/C2H8O7P2.2Na/c1-2(3,10(4,5)6)11(7,8)9;;/h3H,1H3,(H2,4,5,6)(H2,7,8,9);;/q;2*+1/p-2 |
|
| inchikey |
GWBBVOVXJZATQQ-UHFFFAOYSA-L |
|
| label |
etidronate disodium |
|
| mass |
249.99190 |
|
| monoisotopicmass |
249.93842 |
|
| notation |
CHEBI:4906 |
|
| prefLabel |
etidronate disodium |
|
| smiles |
[Na+].[Na+].CC(O)(P(O)([O-])=O)P(O)([O-])=O |
|
| treeView | ||
| subClassOf |