loading...| Preferred Name |
dobutamine hydrochloride |
|
| Synonyms |
N-[2-(3,4-dihydroxyphenyl)ethyl]-4-(4-hydroxyphenyl)butan-2-aminium chloride 4-(2-{[4-(4-hydroxyphenyl)butan-2-yl]amino}ethyl)benzene-1,2-diol hydrochloride dobutamine HCl DL-dobutamine hydrochloride (+-)-4-(2-((3-(p-hydroxyphenyl)-1-methylpropyl)amino)ethyl)pyrocatechol hydrochloride |
|
| Definitions |
The hydrochloride salt of dobutamine. A beta1-adrenergic receptor agonist that has cardiac stimulant action without evoking vasoconstriction or tachycardia, it is used to increase the contractility of the heart in the management of acute heart failure. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4671 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:49745-95-1 Beilstein:6023420 DrugBank:DB00841 KEGG:D00632 |
|
| definition |
The hydrochloride salt of dobutamine. A beta1-adrenergic receptor agonist that has cardiac stimulant action without evoking vasoconstriction or tachycardia, it is used to increase the contractility of the heart in the management of acute heart failure. |
|
| formula |
C18H24ClNO3 |
|
| has part | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35524 |
|
| has_exact_synonym |
N-[2-(3,4-dihydroxyphenyl)ethyl]-4-(4-hydroxyphenyl)butan-2-aminium chloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
4-(2-{[4-(4-hydroxyphenyl)butan-2-yl]amino}ethyl)benzene-1,2-diol hydrochloride dobutamine HCl DL-dobutamine hydrochloride (+-)-4-(2-((3-(p-hydroxyphenyl)-1-methylpropyl)amino)ethyl)pyrocatechol hydrochloride |
|
| id |
CHEBI:4671 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H23NO3.ClH/c1-13(2-3-14-4-7-16(20)8-5-14)19-11-10-15-6-9-17(21)18(22)12-15;/h4-9,12-13,19-22H,2-3,10-11H2,1H3;1H |
|
| inchikey |
BQKADKWNRWCIJL-UHFFFAOYSA-N |
|
| label |
dobutamine hydrochloride |
|
| mass |
337.84100 |
|
| monoisotopicmass |
337.14447 |
|
| notation |
CHEBI:4671 |
|
| prefLabel |
dobutamine hydrochloride |
|
| smiles |
[Cl-].CC(CCc1ccc(O)cc1)[NH2+]CCc1ccc(O)c(O)c1 |
|
| treeView | ||
| subClassOf |