Preferred Name |
dobutamine |
|
Synonyms |
DOBUTAMINE 4-(2-{[4-(4-hydroxyphenyl)butan-2-yl]amino}ethyl)benzene-1,2-diol Dobutamine 4-{2-[3-(4-Hydroxy-phenyl)-1-methyl-propylamino]-ethyl}-benzene-1,2-diol DL-dobutamine 3,4-dihydroxy-N-[3-(4-hydroxyphenyl)-1-methylpropyl]-beta-phenylethylamine dobutamine dobutaminum (+-)-4-(2-((3-(p-hydroxyphenyl)-1-methylpropyl)amino)ethyl)pyrocatechol racemic-dobutamine rac-dobutamine dobutamina |
|
Definitions |
A catecholamine that is 4-(3-aminobutyl)phenol in which one of the hydrogens attached to the nitrogen is substituted by a 2-(3,4-dihydroxyphenyl)ethyl group. A beta1-adrenergic receptor agonist that has cardiac stimulant action without evoking vasoconstriction or tachycardia, it is used as the hydrochloride to increase the contractility of the heart in the management of acute heart failure. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4670 |
|
charge |
0 |
|
database_cross_reference |
PMID:18323735 Patent:DE2317710 KEGG:C06967 DrugBank:DB00841 KEGG:D03879 Beilstein:2946389 LINCS:LSM-1807 HMDB:HMDB0014979 PMID:11950781 CAS:34368-04-2 PMID:11280019 Wikipedia:Dobutamine Drug_Central:937 PMID:22537238 Patent:US3987200 Reaxys:2946389 |
|
definition |
A catecholamine that is 4-(3-aminobutyl)phenol in which one of the hydrogens attached to the nitrogen is substituted by a 2-(3,4-dihydroxyphenyl)ethyl group. A beta1-adrenergic receptor agonist that has cardiac stimulant action without evoking vasoconstriction or tachycardia, it is used as the hydrochloride to increase the contractility of the heart in the management of acute heart failure. |
|
formula |
C18H23NO3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35524 |
|
has_alternative_id |
CHEBI:554519 CHEBI:184505 |
|
has_exact_synonym |
DOBUTAMINE 4-(2-{[4-(4-hydroxyphenyl)butan-2-yl]amino}ethyl)benzene-1,2-diol Dobutamine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
4-{2-[3-(4-Hydroxy-phenyl)-1-methyl-propylamino]-ethyl}-benzene-1,2-diol DL-dobutamine 3,4-dihydroxy-N-[3-(4-hydroxyphenyl)-1-methylpropyl]-beta-phenylethylamine dobutamine dobutaminum (+-)-4-(2-((3-(p-hydroxyphenyl)-1-methylpropyl)amino)ethyl)pyrocatechol racemic-dobutamine rac-dobutamine dobutamina |
|
id |
CHEBI:4670 |
|
in_subset | ||
inchi |
InChI=1S/C18H23NO3/c1-13(2-3-14-4-7-16(20)8-5-14)19-11-10-15-6-9-17(21)18(22)12-15/h4-9,12-13,19-22H,2-3,10-11H2,1H3 |
|
inchikey |
JRWZLRBJNMZMFE-UHFFFAOYSA-N |
|
label |
dobutamine |
|
mass |
301.38010 |
|
monoisotopicmass |
301.16779 |
|
notation |
CHEBI:4670 |
|
prefLabel |
dobutamine |
|
smiles |
CC(CCc1ccc(O)cc1)NCCc1ccc(O)c(O)c1 |
|
treeView | ||
subClassOf |