loading...| Preferred Name | dipivefrin | |
| Synonyms |
Dipivefrine 4-[1-hydroxy-2-(methylamino)ethyl]-o-phenylene divavalate (+-)-4-[1-hydroxy-2-(methylamino)ethyl]-o-phenylene divavalate dipivefrina dipivefrine 1-(3',4'-dipivaloyloxyphenyl)-2-methylamino-1-ethanol dipivefrinum dipivalyl epinephrine Dipivefrin 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diyl bis(2,2-dimethylpropanoate) |
|
| Definitions |
The dipivalate ester of (+-)-epinephrine (racepinephrine). A pro-drug of epinephrine, the hydrochloride is used topically as eye drops to reduce intra-ocular pressure in the treatment of open-angle glaucoma or ocular hypertension. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4646 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:2165183 CAS:52365-63-6 Patent:DE2152058 Patent:DE2343657 DrugBank:DB00449 KEGG:D02349 LINCS:LSM-1583 Drug_Central:922 KEGG:C06963 Wikipedia:Dipivefrin Patent:US4085270 Patent:US3809714 |
|
| definition |
The dipivalate ester of (+-)-epinephrine (racepinephrine). A pro-drug of epinephrine, the hydrochloride is used topically as eye drops to reduce intra-ocular pressure in the treatment of open-angle glaucoma or ocular hypertension. |
|
| formula |
C19H29NO5 |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_39456 http://purl.obolibrary.org/obo/CHEBI_35524 http://purl.obolibrary.org/obo/CHEBI_37886 |
|
| has_exact_synonym |
Dipivefrin 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diyl bis(2,2-dimethylpropanoate) |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Dipivefrine 4-[1-hydroxy-2-(methylamino)ethyl]-o-phenylene divavalate (+-)-4-[1-hydroxy-2-(methylamino)ethyl]-o-phenylene divavalate dipivefrina dipivefrine 1-(3',4'-dipivaloyloxyphenyl)-2-methylamino-1-ethanol dipivefrinum dipivalyl epinephrine |
|
| id |
CHEBI:4646 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H29NO5/c1-18(2,3)16(22)24-14-9-8-12(13(21)11-20-7)10-15(14)25-17(23)19(4,5)6/h8-10,13,20-21H,11H2,1-7H3 |
|
| inchikey |
OCUJLLGVOUDECM-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
dipivefrin |
|
| mass |
351.43730 |
|
| monoisotopicmass |
351.20457 |
|
| notation |
CHEBI:4646 |
|
| prefLabel |
dipivefrin |
|
| smiles |
CNCC(O)c1ccc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c1 |
|
| treeView | ||
| subClassOf |