Preferred Name |
5-fluorouracil |
|
Synonyms |
5-Fluorouracil 5-fluorouracil 5-fluoropyrimidine-2,4(1H,3H)-dione 5-FU Fluorouracil fluorouracil fluorouracilo fluorouracilum 5-Fluoracil 5-Fluoropyrimidine-2,4-dione |
|
Definitions |
A nucleobase analogue that is uracil in which the hydrogen at position 5 is replaced by fluorine. It is an antineoplastic agent which acts as an antimetabolite - following conversion to the active deoxynucleotide, it inhibits DNA synthesis (by blocking the conversion of deoxyuridylic acid to thymidylic acid by the cellular enzyme thymidylate synthetase) and so slows tumour growth. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_46345 |
|
charge |
0 |
|
database_cross_reference |
PMID:11356943 KEGG:D00584 KEGG:C07649 PMID:14769231 PDBeChem:URF CAS:51-21-8 DrugBank:DB00544 PMID:12520460 LINCS:LSM-4261 Reaxys:127172 HMDB:HMDB0014684 Wikipedia:Fluorouracil Beilstein:127172 Drug_Central:26 PMID:19023200 |
|
definition |
A nucleobase analogue that is uracil in which the hydrogen at position 5 is replaced by fluorine. It is an antineoplastic agent which acts as an antimetabolite - following conversion to the active deoxynucleotide, it inhibits DNA synthesis (by blocking the conversion of deoxyuridylic acid to thymidylic acid by the cellular enzyme thymidylate synthetase) and so slows tumour growth. |
|
formula |
C4H3FN2O2 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35705 http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_35221 |
|
has_alternative_id |
CHEBI:2054 CHEBI:46343 |
|
has_exact_synonym |
5-Fluorouracil 5-fluorouracil 5-fluoropyrimidine-2,4(1H,3H)-dione |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
5-FU Fluorouracil fluorouracil fluorouracilo fluorouracilum 5-Fluoracil 5-Fluoropyrimidine-2,4-dione |
|
id |
CHEBI:46345 |
|
in_subset | ||
inchi |
InChI=1S/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
|
inchikey |
GHASVSINZRGABV-UHFFFAOYSA-N |
|
label |
5-fluorouracil |
|
mass |
130.07730 |
|
monoisotopicmass |
130.01786 |
|
notation |
CHEBI:46345 |
|
prefLabel |
5-fluorouracil |
|
smiles |
Fc1c[nH]c(=O)[nH]c1=O |
|
treeView | ||
subClassOf |